The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(4-Cyano-3-(trifluoromethyl)phenyl)-3-((4-fluorophenyl)(phenyl)amino)-2-hydroxy-2-methylpropanamide ID: ALA4877240
PubChem CID: 122650700
Max Phase: Preclinical
Molecular Formula: C24H19F4N3O2
Molecular Weight: 457.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[C@](O)(CN(c1ccccc1)c1ccc(F)cc1)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1
Standard InChI: InChI=1S/C24H19F4N3O2/c1-23(33,22(32)30-18-10-7-16(14-29)21(13-18)24(26,27)28)15-31(19-5-3-2-4-6-19)20-11-8-17(25)9-12-20/h2-13,33H,15H2,1H3,(H,30,32)/t23-/m0/s1
Standard InChI Key: AKYKJSORIJFXQN-QHCPKHFHSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
4.7709 -21.1169 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.9459 -21.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3584 -21.8314 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.3875 -17.9127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8043 -18.6293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2166 -17.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2361 -19.0544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2350 -19.8817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9497 -20.2946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6662 -19.8812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6634 -19.0507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9480 -18.6416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3762 -18.6355 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0923 -19.0453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0955 -19.8703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5202 -20.2937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8053 -20.7056 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5213 -19.0399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2350 -21.5319 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.2342 -18.6249 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9502 -19.0349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2313 -17.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9502 -19.8596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6654 -20.2695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3794 -19.8544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3737 -19.0252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6581 -18.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9444 -17.3904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9417 -16.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2252 -16.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5100 -16.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5160 -17.3978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0958 -20.2634 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 1
6 5 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
11 13 1 0
13 14 1 0
14 5 1 0
14 15 2 0
8 16 1 0
16 17 3 0
5 18 1 0
9 2 1 0
2 19 1 0
18 20 1 0
20 21 1 0
20 22 1 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 21 1 0
22 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 22 1 0
25 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.43Molecular Weight (Monoisotopic): 457.1413AlogP: 5.24#Rotatable Bonds: 6Polar Surface Area: 76.36Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.15CX Basic pKa: 1.30CX LogP: 5.38CX LogD: 5.38Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -1.37
References 1. He Y, Hwang DJ, Ponnusamy S, Thiyagarajan T, Mohler ML, Narayanan R, Miller DD.. (2021) Exploration and Biological Evaluation of Basic Heteromonocyclic Propanamide Derivatives as SARDs for the Treatment of Enzalutamide-Resistant Prostate Cancer., 64 (15.0): [PMID:34269581 ] [10.1021/acs.jmedchem.1c00439 ]