N-((3-tert-butyl-1-(3-chlorophenyl)-1H-pyrazol-5-yl)methyl)-2-(4-fluoro-3-(trifluoromethyl)phenyl)acetamide

ID: ALA4877286

PubChem CID: 164628916

Max Phase: Preclinical

Molecular Formula: C23H22ClF4N3O

Molecular Weight: 467.89

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)c1cc(CNC(=O)Cc2ccc(F)c(C(F)(F)F)c2)n(-c2cccc(Cl)c2)n1

Standard InChI:  InChI=1S/C23H22ClF4N3O/c1-22(2,3)20-12-17(31(30-20)16-6-4-5-15(24)11-16)13-29-21(32)10-14-7-8-19(25)18(9-14)23(26,27)28/h4-9,11-12H,10,13H2,1-3H3,(H,29,32)

Standard InChI Key:  IFKUEWUROQKKJP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    0.7491  -12.1525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5717  -12.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1822  -13.5162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9702  -13.2650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1442  -12.4529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5325  -11.9008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5813  -13.8192    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.7057  -11.0942    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4546  -10.7581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3702   -9.9374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5635   -9.7642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1496  -10.4777    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1692  -11.1704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8835  -10.7576    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5981  -11.1698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3124  -10.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5984  -11.9948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0270  -11.1692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0242  -11.9926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7380  -12.4047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4533  -11.9919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4504  -11.1627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7360  -10.7543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1632  -10.7474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8792  -11.1571    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.1600   -9.9224    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.8748  -10.3289    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.1684  -12.4032    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2295   -9.0098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7159   -8.3434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4093   -8.9218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0125   -8.2081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
  9 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 22 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
 21 28  1  0
 11 29  1  0
 29 30  1  0
 29 31  1  0
 29 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877286

    ---

Associated Targets(Human)

TRPV1 Tclin Vanilloid receptor (8273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 467.89Molecular Weight (Monoisotopic): 467.1388AlogP: 5.84#Rotatable Bonds: 5
Polar Surface Area: 46.92Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.51CX Basic pKa: 2.02CX LogP: 6.31CX LogD: 6.31
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -1.92

References

1. Kang JM, Kwon SO, Ann J, Lee S, Kim C, Do N, Jeong JJ, Blumberg PM, Ha H, Vu TNL, Yoon S, Choi S, Frank-Foltyn R, Lesch B, Bahrenberg G, Stockhausen H, Christoph T, Lee J..  (2021)  2-(Halogenated Phenyl) acetamides and propanamides as potent TRPV1 antagonists.,  48  [PMID:34273488] [10.1016/j.bmcl.2021.128266]

Source