N-(4-((1-Ethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)oxy)phenyl)-2,5-dimethylbenzene-sulfonamide

ID: ALA4877290

PubChem CID: 164628919

Max Phase: Preclinical

Molecular Formula: C25H23N5O3S

Molecular Weight: 473.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1nnc2c(Oc3ccc(NS(=O)(=O)c4cc(C)ccc4C)cc3)nc3ccccc3n12

Standard InChI:  InChI=1S/C25H23N5O3S/c1-4-23-27-28-24-25(26-20-7-5-6-8-21(20)30(23)24)33-19-13-11-18(12-14-19)29-34(31,32)22-15-16(2)9-10-17(22)3/h5-15,29H,4H2,1-3H3

Standard InChI Key:  WFOSOZFYXYBSLY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    7.1773  -14.2554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5994  -14.8374    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.3923  -15.0468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8846  -14.4485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8629  -13.6304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1443  -13.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4474  -13.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4711  -14.4849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1897  -14.8740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6027  -15.6580    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3126  -16.0694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0168  -15.6552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7267  -16.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7283  -16.8837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0200  -17.2937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3101  -16.8865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4341  -17.2909    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1472  -19.3325    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1456  -18.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4357  -18.1081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7274  -18.5181    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7291  -19.3353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0249  -19.7453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0266  -20.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7323  -20.9697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4406  -20.5597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4390  -19.7425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4038  -18.9213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9223  -18.2590    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9209  -19.5856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1771  -20.3623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6330  -20.9720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7752  -14.9133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5593  -13.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  2  0
  2 10  1  0
  4  2  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 11 16  2  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 18 27  1  0
 22 27  2  0
 28 29  1  0
 28 30  2  0
 18 30  1  0
 19 29  2  0
 30 31  1  0
 17 20  1  0
 14 17  1  0
 10 11  1  0
 31 32  1  0
  8 33  1  0
  5 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877290

    ---

Associated Targets(non-human)

Slc14a2 Urea transporter 2 (74 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 473.56Molecular Weight (Monoisotopic): 473.1522AlogP: 5.05#Rotatable Bonds: 6
Polar Surface Area: 98.48Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.09CX Basic pKa: 1.54CX LogP: 4.42CX LogD: 4.35
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.37Np Likeness Score: -1.99

References

1. Lee S, Lee S, Cil O, Diez-Cecilia E, Anderson MO, Verkman AS..  (2018)  Nanomolar-Potency 1,2,4-Triazoloquinoxaline Inhibitors of the Kidney Urea Transporter UT-A1.,  61  (7.0): [PMID:29589443] [10.1021/acs.jmedchem.8b00343]

Source