The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(2-(2-((R)-3-((5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl)amino)piperidin-1-yl)ethoxy)ethoxy)ethyl)-2-((2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)oxy)acetamide ID: ALA4877305
PubChem CID: 155235770
Max Phase: Preclinical
Molecular Formula: C38H41ClN8O8
Molecular Weight: 773.25
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)NCCOCCOCCN1CCC[C@@H](Nc2ncc(Cl)c(-c3c[nH]c4ccccc34)n2)C1
Standard InChI: InChI=1S/C38H41ClN8O8/c39-27-20-42-38(45-34(27)26-19-41-28-8-2-1-6-24(26)28)43-23-5-4-13-46(21-23)14-16-54-18-17-53-15-12-40-32(49)22-55-30-9-3-7-25-33(30)37(52)47(36(25)51)29-10-11-31(48)44-35(29)50/h1-3,6-9,19-20,23,29,41H,4-5,10-18,21-22H2,(H,40,49)(H,42,43,45)(H,44,48,50)/t23-,29?/m1/s1
Standard InChI Key: IETJBBZPLGKKMZ-WIZGVZBGSA-N
Molfile:
RDKit 2D
55 61 0 0 0 0 0 0 0 0999 V2000
33.5960 -27.0539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8896 -27.4649 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1805 -27.0587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4742 -27.4697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1778 -26.2415 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.7651 -27.0635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.0588 -27.4745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6476 -28.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3617 -28.7018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0646 -28.2892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6453 -27.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3484 -27.0649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1730 -26.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3614 -26.1893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0354 -26.9366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9498 -25.4823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3553 -24.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9449 -24.0691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.1274 -24.0710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7219 -24.7816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1339 -25.4903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7153 -25.6573 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2373 -27.1124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7162 -23.3648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1724 -24.7676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.2729 -27.0606 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.9809 -27.4685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2721 -26.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9795 -25.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6924 -27.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6917 -26.2380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4046 -27.4673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.1161 -27.0580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8234 -27.4685 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.5344 -27.0599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5341 -26.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8169 -25.8258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1089 -26.2409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.2478 -27.4653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3335 -28.2821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1371 -28.4558 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.9983 -27.1326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.5409 -27.7447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.3408 -27.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.5991 -26.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0474 -26.1883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2495 -26.3580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2450 -25.8235 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
37.1338 -27.4682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.8453 -27.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5575 -27.4670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4268 -27.0585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7184 -27.4659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0114 -27.0562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3030 -27.4636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
3 5 2 0
4 6 1 0
6 7 1 0
7 12 2 0
11 8 2 0
8 9 1 0
9 10 2 0
10 7 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
16 17 1 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
14 16 1 0
13 22 2 0
15 23 2 0
19 24 2 0
17 25 2 0
26 27 1 0
26 28 1 0
28 29 1 0
27 30 1 0
29 31 1 0
30 31 1 0
30 32 1 1
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
39 40 2 0
40 41 1 0
41 43 1 0
42 39 1 0
35 39 1 0
42 43 2 0
43 44 1 0
44 45 2 0
45 46 1 0
46 47 2 0
47 42 1 0
36 48 1 0
49 50 1 0
50 51 1 0
51 26 1 0
49 52 1 0
52 53 1 0
53 54 1 0
54 55 1 0
55 1 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 773.25Molecular Weight (Monoisotopic): 772.2736AlogP: 2.78#Rotatable Bonds: 16Polar Surface Area: 197.18Molecular Species: NEUTRALHBA: 12HBD: 4#RO5 Violations: 2HBA (Lipinski): 16HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.59CX Basic pKa: 8.06CX LogP: 1.91CX LogD: 1.16Aromatic Rings: 4Heavy Atoms: 55QED Weighted: 0.10Np Likeness Score: -1.07
References 1. (2020) Degraders of cyclin-dependent kinase 12 (cdk12) and uses thereof,