The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4877315
PubChem CID: 164629164
Max Phase: Preclinical
Molecular Formula: C17H17NO6S
Molecular Weight: 363.39
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC1=C(Cc2ccc(OC)cc2)C(=O)C2=C(NCCS2(=O)=O)C1=O
Standard InChI: InChI=1S/C17H17NO6S/c1-23-11-5-3-10(4-6-11)9-12-14(19)17-13(15(20)16(12)24-2)18-7-8-25(17,21)22/h3-6,18H,7-9H2,1-2H3
Standard InChI Key: UZHWVXOSIYKPMU-UHFFFAOYSA-N
Molfile:
RDKit 2D
25 27 0 0 0 0 0 0 0 0999 V2000
5.7699 -5.7451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1826 -6.4550 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.5910 -5.7426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4810 -6.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4810 -7.6849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1862 -8.0894 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8915 -6.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8880 -7.6849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5901 -8.0942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3001 -7.6909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3036 -6.8737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5970 -6.4599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0135 -6.4688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7190 -6.8812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7126 -7.6983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4173 -8.1106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1281 -7.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1298 -6.8842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4245 -6.4757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8342 -8.1170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8310 -8.9342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0055 -8.1035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0009 -8.9206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5855 -8.9114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5994 -5.6427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 2 1 0
5 6 1 0
6 8 1 0
7 2 1 0
7 8 2 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
11 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 1 0
10 22 1 0
22 23 1 0
9 24 2 0
12 25 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 363.39Molecular Weight (Monoisotopic): 363.0777AlogP: 0.52#Rotatable Bonds: 4Polar Surface Area: 98.77Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 0.32CX LogD: 0.32Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.78Np Likeness Score: 0.64
References 1. Dziwornu GA, Attram HD, Gachuhi S, Chibale K.. (2020) Chemotherapy for human schistosomiasis: how far have we come? What's new? Where do we go from here?, 11 (4.0): [PMID:33479649 ] [10.1039/D0MD00062K ] 2. Patel OPS, Beteck RM, Legoabe LJ.. (2021) Antimalarial application of quinones: A recent update., 210 [PMID:33333397 ] [10.1016/j.ejmech.2020.113084 ]