4-(2-((2,3-Dichlorobenzyl)amino)-2-oxoethoxy)-N-(2,3-dimethylphenyl)benzamide

ID: ALA4877320

PubChem CID: 164629167

Max Phase: Preclinical

Molecular Formula: C24H22Cl2N2O3

Molecular Weight: 457.36

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(NC(=O)c2ccc(OCC(=O)NCc3cccc(Cl)c3Cl)cc2)c1C

Standard InChI:  InChI=1S/C24H22Cl2N2O3/c1-15-5-3-8-21(16(15)2)28-24(30)17-9-11-19(12-10-17)31-14-22(29)27-13-18-6-4-7-20(25)23(18)26/h3-12H,13-14H2,1-2H3,(H,27,29)(H,28,30)

Standard InChI Key:  XVQJYTIRUPNZAV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    2.4926  -29.9994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2022  -29.5899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2022  -28.7673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4908  -28.3620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7845  -28.7693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7845  -29.5904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0765  -29.9984    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.9106  -29.9974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6176  -29.5877    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3260  -29.9952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0331  -29.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7414  -29.9930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4485  -29.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1540  -29.9910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8597  -29.5819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8597  -28.7639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1464  -28.3566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4485  -28.7679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5663  -28.3532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5663  -27.5360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2751  -28.7598    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9817  -28.3491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6877  -28.7562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3937  -28.3462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3937  -27.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6779  -27.1218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9817  -27.5341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1024  -28.7531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6877  -29.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3260  -30.8124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4924  -30.8244    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  6  5  2  0
  6  1  1  0
  6  7  1  0
  2  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 16 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 24 28  1  0
 23 29  1  0
 10 30  2  0
  1 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877320

    ---

Associated Targets(Human)

MEIS1 Tbio Homeobox protein Meis1 (130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 457.36Molecular Weight (Monoisotopic): 456.1007AlogP: 5.56#Rotatable Bonds: 7
Polar Surface Area: 67.43Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.70CX Basic pKa: CX LogP: 5.76CX LogD: 5.76
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.49Np Likeness Score: -1.78

References

1. Turgutalp B, Uslu M, Helvacioglu S, Charehsaz M, Gurdal EE, Sippl W, Kocabas F, Yarim M..  (2021)  Lead Optimization and Structure-Activity Relationship Studies on Myeloid Ecotropic Viral Integration Site 1 Inhibitor.,  64  (19.0): [PMID:34542289] [10.1021/acs.jmedchem.1c00972]

Source