The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2,6-Dimethylpyridin-4-yl)(4-(7-(trans-4-hydroxycydohexyl)-2-(((S)-pentan-2-yl)amino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl)piperidin-1-yl)methanone ID: ALA4877347
Cas Number: 2226789-82-6
PubChem CID: 146403042
Product Number: U646558, Order Now?
Max Phase: Preclinical
Molecular Formula: C30H42N6O2
Molecular Weight: 518.71
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCC[C@H](C)Nc1ncc2c(C3CCN(C(=O)c4cc(C)nc(C)c4)CC3)cn([C@H]3CC[C@H](O)CC3)c2n1
Standard InChI: InChI=1S/C30H42N6O2/c1-5-6-19(2)33-30-31-17-26-27(18-36(28(26)34-30)24-7-9-25(37)10-8-24)22-11-13-35(14-12-22)29(38)23-15-20(3)32-21(4)16-23/h15-19,22,24-25,37H,5-14H2,1-4H3,(H,31,33,34)/t19-,24-,25-/m0/s1
Standard InChI Key: MSWOWUREQODTRO-LQGLAIQGSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
13.8776 -16.1040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8764 -16.9313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5913 -17.3442 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5895 -15.6912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3048 -16.1004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3051 -16.9268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0912 -17.1820 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5769 -16.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0908 -15.8447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3464 -17.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7949 -18.5753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0471 -19.3570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8536 -19.5325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4075 -18.9199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1550 -18.1318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1058 -20.3180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1617 -17.3433 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4475 -16.9302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7328 -17.3422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0186 -16.9291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3038 -17.3410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4482 -16.1052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3488 -15.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1570 -14.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4125 -14.1131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8632 -13.4970 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0549 -13.6670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7960 -14.4532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1208 -12.7133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9283 -12.5445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5709 -12.0983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4754 -13.1595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2822 -12.9913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5406 -12.2068 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9858 -11.5904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1810 -11.7618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2408 -10.8058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8319 -13.6065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 7 1 1
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
13 16 1 6
2 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
18 22 1 6
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
9 23 1 0
26 29 1 0
29 30 1 0
29 31 2 0
30 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 30 1 0
35 37 1 0
33 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 518.71Molecular Weight (Monoisotopic): 518.3369AlogP: 5.54#Rotatable Bonds: 7Polar Surface Area: 96.17Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.96CX LogP: 3.66CX LogD: 3.64Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.43Np Likeness Score: -0.79
References 1. Zheng H, Zhao J, Li B, Zhang W, Stashko MA, Minson KA, Huey MG, Zhou Y, Earp HS, Kireev D, Graham DK, DeRyckere D, Frye SV, Wang X.. (2021) UNC5293, a potent, orally available and highly MERTK-selective inhibitor., 220 [PMID:34038857 ] [10.1016/j.ejmech.2021.113534 ]