The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(1-(5,6-dihydroxybenzo[d]thiazol-2-ylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl)benzamide ID: ALA4877369
PubChem CID: 164626227
Max Phase: Preclinical
Molecular Formula: C23H19N3O5S
Molecular Weight: 449.49
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N[C@@H](Cc1ccc(O)cc1)C(=O)Nc1nc2cc(O)c(O)cc2s1)c1ccccc1
Standard InChI: InChI=1S/C23H19N3O5S/c27-15-8-6-13(7-9-15)10-17(24-21(30)14-4-2-1-3-5-14)22(31)26-23-25-16-11-18(28)19(29)12-20(16)32-23/h1-9,11-12,17,27-29H,10H2,(H,24,30)(H,25,26,31)/t17-/m0/s1
Standard InChI Key: AVYZDYVFRJSUDS-KRWDZBQOSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
2.8944 -20.1164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8933 -20.9438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6080 -21.3566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6062 -19.7037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3216 -20.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3219 -20.9392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1080 -21.1944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5936 -20.5256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1075 -19.8572 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.1798 -19.7041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1784 -21.3557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4186 -20.5253 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8308 -19.8107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6558 -19.8104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4181 -19.0963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0686 -20.5246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0680 -19.0957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6553 -18.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6563 -21.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0691 -21.9537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8313 -21.2396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6537 -22.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0658 -23.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8916 -23.3772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3037 -22.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8892 -21.9467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0702 -17.6701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6582 -16.9562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8323 -16.9560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4202 -17.6757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8346 -18.3865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4186 -16.2423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
1 10 1 0
2 11 1 0
8 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
14 17 1 6
17 18 1 0
16 19 1 0
19 20 1 0
19 21 2 0
20 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 20 1 0
18 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 18 1 0
29 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.49Molecular Weight (Monoisotopic): 449.1045AlogP: 3.39#Rotatable Bonds: 6Polar Surface Area: 131.78Molecular Species: NEUTRALHBA: 7HBD: 5#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.62CX Basic pKa: 0.18CX LogP: 4.10CX LogD: 3.89Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.29Np Likeness Score: -0.89
References 1. Maus H, Barthels F, Hammerschmidt SJ, Kopp K, Millies B, Gellert A, Ruggieri A, Schirmeister T.. (2021) SAR of novel benzothiazoles targeting an allosteric pocket of DENV and ZIKV NS2B/NS3 proteases., 47 [PMID:34509861 ] [10.1016/j.bmc.2021.116392 ]