The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-chloro-N2-(4-((2-(dimethylamino)ethyl)(methyl)amino)-2-methoxyphenyl)-N4-(2-(ethylsulfinyl)-4-fluorophenyl)pyrimidine-2,4-diamine ID: ALA4877409
PubChem CID: 164627272
Max Phase: Preclinical
Molecular Formula: C24H30ClFN6O2S
Molecular Weight: 521.06
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC[S+]([O-])c1cc(F)ccc1Nc1nc(Nc2ccc(N(C)CCN(C)C)cc2OC)ncc1Cl
Standard InChI: InChI=1S/C24H30ClFN6O2S/c1-6-35(33)22-13-16(26)7-9-20(22)28-23-18(25)15-27-24(30-23)29-19-10-8-17(14-21(19)34-5)32(4)12-11-31(2)3/h7-10,13-15H,6,11-12H2,1-5H3,(H2,27,28,29,30)
Standard InChI Key: VLAHZAGOOADEEK-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
40.9784 -4.6958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9772 -5.5233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6920 -5.9362 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.4084 -5.5228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4056 -4.6922 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.6902 -4.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2638 -4.2835 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
41.6877 -3.4581 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.9720 -3.0477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9729 -2.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2580 -1.8132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5439 -2.2278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5489 -3.0571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2644 -3.4636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6871 -1.8105 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
42.4019 -2.2224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6865 -0.9854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.1236 -5.9342 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.2638 -7.1698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1249 -6.7592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4097 -7.1712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4107 -7.9955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1263 -8.4077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8425 -7.9896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8381 -7.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5505 -6.7507 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.1160 -1.8094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1288 -9.2327 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.4155 -9.6473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8444 -9.6431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8468 -10.4681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5625 -10.8785 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.5649 -11.7036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2758 -10.4640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8276 -1.8184 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
6 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
10 15 1 0
15 16 1 0
15 17 1 0
4 18 1 0
26 19 1 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
25 26 1 0
16 27 1 0
23 28 1 0
28 29 1 0
28 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
32 34 1 0
12 35 1 0
M CHG 2 15 1 17 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 521.06Molecular Weight (Monoisotopic): 520.1824AlogP: 4.89#Rotatable Bonds: 11Polar Surface Area: 88.61Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.21CX Basic pKa: 8.93CX LogP: 4.16CX LogD: 2.63Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.35Np Likeness Score: -1.44
References 1. Wu F, Yao H, Li W, Zhang N, Fan Y, Chan ASC, Li X, An B.. (2021) Synthesis and evaluation of novel 2,4-diaminopyrimidines bearing a sulfoxide moiety as anaplastic lymphoma kinase (ALK) inhibition agents., 48 [PMID:34245852 ] [10.1016/j.bmcl.2021.128253 ]