(E)-N'-((2,3-dihydrobenzo[b][1,4]dioxin-6-yl)methylene)-5-(naphthalen-2-yl)-1H-pyrazole-3-carbohydrazide

ID: ALA4877410

PubChem CID: 164627273

Max Phase: Preclinical

Molecular Formula: C23H18N4O3

Molecular Weight: 398.42

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(N/N=C/c1ccc2c(c1)OCCO2)c1cc(-c2ccc3ccccc3c2)[nH]n1

Standard InChI:  InChI=1S/C23H18N4O3/c28-23(27-24-14-15-5-8-21-22(11-15)30-10-9-29-21)20-13-19(25-26-20)18-7-6-16-3-1-2-4-17(16)12-18/h1-8,11-14H,9-10H2,(H,25,26)(H,27,28)/b24-14+

Standard InChI Key:  LPLGIDPZKBFFCH-ZVHZXABRSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   14.4645   -4.2758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4634   -5.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1714   -5.5043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1696   -3.8669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8783   -4.2722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8790   -5.0912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5875   -5.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2958   -5.0874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2911   -4.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5820   -3.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9954   -3.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7440   -4.1778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2871   -3.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8741   -2.8619    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0759   -3.0368    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.1003   -3.6477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4372   -4.3922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5766   -2.9836    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.3898   -3.0641    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8661   -2.4001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6793   -2.4806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0140   -3.2272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8264   -3.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3036   -2.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9625   -1.8962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1511   -1.8190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1169   -2.7228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.4364   -1.2304    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.2499   -1.3080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5895   -2.0514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 11  1  0
  9 11  1  0
 13 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 25 28  1  0
 28 29  1  0
 27 30  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877410

    ---

Associated Targets(Human)

SPHK1 Tchem Sphingosine kinase 1 (1990 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 398.42Molecular Weight (Monoisotopic): 398.1379AlogP: 3.77#Rotatable Bonds: 4
Polar Surface Area: 88.60Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.06CX Basic pKa: 2.04CX LogP: 3.72CX LogD: 3.71
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.40Np Likeness Score: -1.50

References

1. Butler KJ, Castro AA, Dwyer TS, Hardwick LM, Iacino MC, Manore SG, Mays KM, McGlade CA, Hair LN, Parker EW, Smith MR, Turnow MT, Wilson MR, Woodson SR, Cotham WE, Walla MD, Hurlbert JC, Christian Grattan T..  (2021)  Design, synthesis and analysis of novel sphingosine kinase-1 inhibitors to improve oral bioavailability.,  50  [PMID:34418572] [10.1016/j.bmcl.2021.128329]

Source