The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4877437
PubChem CID: 164627487
Max Phase: Preclinical
Molecular Formula: C22H20O7
Molecular Weight: 396.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)/C=C/c1ccc2c(c1)[C@@H](C(=O)OC)[C@H](c1ccc(OC(C)=O)cc1)O2
Standard InChI: InChI=1S/C22H20O7/c1-13(23)28-16-8-6-15(7-9-16)21-20(22(25)27-3)17-12-14(4-10-18(17)29-21)5-11-19(24)26-2/h4-12,20-21H,1-3H3/b11-5+/t20-,21+/m1/s1
Standard InChI Key: TWHQJJRCIKNOLY-WEEOSXESSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
12.9964 -11.9675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7060 -11.5581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7032 -10.7354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9946 -10.3301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2883 -11.5585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2850 -10.7420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5075 -10.4928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0301 -11.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5128 -11.8139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2175 -11.1594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8066 -10.4517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9902 -10.4547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5837 -11.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9995 -11.8730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8146 -11.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2519 -9.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7963 -9.1063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4519 -9.5490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4094 -10.3242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1186 -10.7301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8248 -10.3188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5340 -10.7247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2402 -10.3135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8217 -9.5016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5963 -9.2730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7665 -11.1690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3541 -10.4635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5369 -10.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7588 -9.7536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 10 1 1
16 17 1 0
16 18 2 0
7 16 1 6
3 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
21 24 2 0
17 25 1 0
13 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 396.40Molecular Weight (Monoisotopic): 396.1209AlogP: 3.19#Rotatable Bonds: 5Polar Surface Area: 88.13Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.31CX LogD: 3.31Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.44Np Likeness Score: 0.99
References 1. Dziwornu GA, Attram HD, Gachuhi S, Chibale K.. (2020) Chemotherapy for human schistosomiasis: how far have we come? What's new? Where do we go from here?, 11 (4.0): [PMID:33479649 ] [10.1039/D0MD00062K ]