NA

ID: ALA4877437

PubChem CID: 164627487

Max Phase: Preclinical

Molecular Formula: C22H20O7

Molecular Weight: 396.40

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)/C=C/c1ccc2c(c1)[C@@H](C(=O)OC)[C@H](c1ccc(OC(C)=O)cc1)O2

Standard InChI:  InChI=1S/C22H20O7/c1-13(23)28-16-8-6-15(7-9-16)21-20(22(25)27-3)17-12-14(4-10-18(17)29-21)5-11-19(24)26-2/h4-12,20-21H,1-3H3/b11-5+/t20-,21+/m1/s1

Standard InChI Key:  TWHQJJRCIKNOLY-WEEOSXESSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   12.9964  -11.9675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7060  -11.5581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7032  -10.7354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9946  -10.3301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2883  -11.5585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2850  -10.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5075  -10.4928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0301  -11.1554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5128  -11.8139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2175  -11.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8066  -10.4517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9902  -10.4547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5837  -11.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9995  -11.8730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8146  -11.8665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2519   -9.7157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7963   -9.1063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4519   -9.5490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4094  -10.3242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1186  -10.7301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8248  -10.3188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5340  -10.7247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2402  -10.3135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8217   -9.5016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5963   -9.2730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7665  -11.1690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3541  -10.4635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5369  -10.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7588   -9.7536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 10  1  1
 16 17  1  0
 16 18  2  0
  7 16  1  6
  3 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 21 24  2  0
 17 25  1  0
 13 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4877437

    ---

Associated Targets(non-human)

Schistosoma mansoni (6170 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 396.40Molecular Weight (Monoisotopic): 396.1209AlogP: 3.19#Rotatable Bonds: 5
Polar Surface Area: 88.13Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.31CX LogD: 3.31
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.44Np Likeness Score: 0.99

References

1. Dziwornu GA, Attram HD, Gachuhi S, Chibale K..  (2020)  Chemotherapy for human schistosomiasis: how far have we come? What's new? Where do we go from here?,  11  (4.0): [PMID:33479649] [10.1039/D0MD00062K]

Source