2-(5-((3-(2-ethylphenyl)-4-methoxynaphthalene)-1-sulfonamido)-2-fluorophenyl)acetic acid

ID: ALA4877441

PubChem CID: 164627490

Max Phase: Preclinical

Molecular Formula: C27H24FNO5S

Molecular Weight: 493.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1ccccc1-c1cc(S(=O)(=O)Nc2ccc(F)c(CC(=O)O)c2)c2ccccc2c1OC

Standard InChI:  InChI=1S/C27H24FNO5S/c1-3-17-8-4-5-9-20(17)23-16-25(21-10-6-7-11-22(21)27(23)34-2)35(32,33)29-19-12-13-24(28)18(14-19)15-26(30)31/h4-14,16,29H,3,15H2,1-2H3,(H,30,31)

Standard InChI Key:  DPYYLXZATUSSII-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    5.7822  -24.0700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9651  -24.0700    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.3737  -24.7777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6776  -22.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6765  -22.8465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3845  -23.2555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0942  -22.8460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0914  -22.0234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3828  -21.6181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9685  -23.2546    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2598  -24.4798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5579  -25.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2625  -25.2926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8455  -25.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7975  -21.6121    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.8479  -24.4778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5524  -24.0725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5527  -23.2616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8492  -22.8550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1440  -23.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1472  -24.0749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8026  -23.2535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5096  -22.8438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2209  -23.2493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5113  -22.0247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1377  -25.7017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4301  -25.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5601  -26.5195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8517  -26.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8536  -27.7415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5630  -28.1489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2719  -27.7340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2665  -26.9190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9711  -26.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6819  -26.9080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  5 10  1  0
 10  2  1  0
  2 11  1  0
 11 17  2  0
 14 12  1  0
 12 13  2  0
 13 11  1  0
 14 16  2  0
  8 15  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  7 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
 14 26  1  0
 26 27  1  0
 12 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 33 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877441

    ---

Associated Targets(Human)

FABP4 Tchem Fatty acid binding protein adipocyte (764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FABP5 Tchem Fatty acid binding protein epidermal (323 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 493.56Molecular Weight (Monoisotopic): 493.1359AlogP: 5.64#Rotatable Bonds: 8
Polar Surface Area: 92.70Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.62CX Basic pKa: CX LogP: 5.68CX LogD: 2.22
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -0.70

References

1. He YL, Chen MT, Wang T, Zhang MM, Li YX, Wang HY, Ding N..  (2021)  Development of FABP4/5 inhibitors with potential therapeutic effect on type 2 Diabetes Mellitus.,  224  [PMID:34332399] [10.1016/j.ejmech.2021.113720]

Source