The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-((3-(2-ethylphenyl)-4-methoxynaphthalene)-1-sulfonamido)-2-fluorophenyl)acetic acid ID: ALA4877441
PubChem CID: 164627490
Max Phase: Preclinical
Molecular Formula: C27H24FNO5S
Molecular Weight: 493.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccccc1-c1cc(S(=O)(=O)Nc2ccc(F)c(CC(=O)O)c2)c2ccccc2c1OC
Standard InChI: InChI=1S/C27H24FNO5S/c1-3-17-8-4-5-9-20(17)23-16-25(21-10-6-7-11-22(21)27(23)34-2)35(32,33)29-19-12-13-24(28)18(14-19)15-26(30)31/h4-14,16,29H,3,15H2,1-2H3,(H,30,31)
Standard InChI Key: DPYYLXZATUSSII-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
5.7822 -24.0700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9651 -24.0700 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.3737 -24.7777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6776 -22.0270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6765 -22.8465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3845 -23.2555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0942 -22.8460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0914 -22.0234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3828 -21.6181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9685 -23.2546 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2598 -24.4798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5579 -25.7023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2625 -25.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8455 -25.2933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7975 -21.6121 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.8479 -24.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5524 -24.0725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5527 -23.2616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8492 -22.8550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1440 -23.2653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1472 -24.0749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8026 -23.2535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5096 -22.8438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2209 -23.2493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5113 -22.0247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1377 -25.7017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4301 -25.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5601 -26.5195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8517 -26.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8536 -27.7415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5630 -28.1489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2719 -27.7340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2665 -26.9190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9711 -26.5049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6819 -26.9080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
5 10 1 0
10 2 1 0
2 11 1 0
11 17 2 0
14 12 1 0
12 13 2 0
13 11 1 0
14 16 2 0
8 15 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
7 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
14 26 1 0
26 27 1 0
12 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
33 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 493.56Molecular Weight (Monoisotopic): 493.1359AlogP: 5.64#Rotatable Bonds: 8Polar Surface Area: 92.70Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.62CX Basic pKa: ┄CX LogP: 5.68CX LogD: 2.22Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -0.70
References 1. He YL, Chen MT, Wang T, Zhang MM, Li YX, Wang HY, Ding N.. (2021) Development of FABP4/5 inhibitors with potential therapeutic effect on type 2 Diabetes Mellitus., 224 [PMID:34332399 ] [10.1016/j.ejmech.2021.113720 ]