N-(thiophen-2-ylmethyl)-4-(p-tolyl)-6-(trifluoromethyl)pyrimidine-2-amine

ID: ALA4877485

PubChem CID: 164627755

Max Phase: Preclinical

Molecular Formula: C17H14F3N3S

Molecular Weight: 349.38

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2cc(C(F)(F)F)nc(NCc3cccs3)n2)cc1

Standard InChI:  InChI=1S/C17H14F3N3S/c1-11-4-6-12(7-5-11)14-9-15(17(18,19)20)23-16(22-14)21-10-13-3-2-8-24-13/h2-9H,10H2,1H3,(H,21,22,23)

Standard InChI Key:  QUDCXDDNLQKLLJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
    8.9066   -9.1005    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.7238   -9.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3152   -8.3928    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.0160  -11.1478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7247  -11.5594    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4334  -11.1478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4334  -10.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7247   -9.9215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0160  -10.3289    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3032  -11.5594    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.1421  -11.5594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1421  -12.3783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5594  -12.3783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8507  -11.1478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8507  -12.7857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5594  -11.5594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2681  -12.7857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5946  -11.1478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8859  -11.5594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1381  -11.2246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5915  -11.8321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9989  -12.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7999  -12.3738    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.4324   -8.6939    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  2  0
  4 10  1  0
  8  2  1  0
 11 12  1  0
 11 14  2  0
 12 15  2  0
 13 15  1  0
 13 16  2  0
 14 16  1  0
 13 17  1  0
  6 11  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 19 23  1  0
 18 19  1  0
 10 18  1  0
  2 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877485

    ---

Associated Targets(Human)

TLR8 Tchem Toll-like receptor 8 (1853 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 349.38Molecular Weight (Monoisotopic): 349.0861AlogP: 5.14#Rotatable Bonds: 4
Polar Surface Area: 37.81Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.91CX Basic pKa: 3.28CX LogP: 5.65CX LogD: 5.65
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.71Np Likeness Score: -2.13

References

1. Dolšak A, Šribar D, Scheffler A, Grabowski M, Švajger U, Gobec S, Holze J, Weindl G, Wolber G, Sova M..  (2021)  Further hit optimization of 6-(trifluoromethyl)pyrimidin-2-amine based TLR8 modulators: Synthesis, biological evaluation and structure-activity relationships.,  225  [PMID:34488023] [10.1016/j.ejmech.2021.113809]

Source