7-(3,5-Dimethylisoxazol-4-yl)-8-methoxy-1-((tetrahydro-2H-pyran-3-yl)methyl)-1H-imidazo[4,5-c]quinoline-2(3H)-one

ID: ALA4877490

PubChem CID: 164628018

Max Phase: Preclinical

Molecular Formula: C22H24N4O4

Molecular Weight: 408.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc2c(cc1-c1c(C)noc1C)ncc1[nH]c(=O)n(CC3CCCOC3)c12

Standard InChI:  InChI=1S/C22H24N4O4/c1-12-20(13(2)30-25-12)16-7-17-15(8-19(16)28-3)21-18(9-23-17)24-22(27)26(21)10-14-5-4-6-29-11-14/h7-9,14H,4-6,10-11H2,1-3H3,(H,24,27)

Standard InChI Key:  OSRHTSPORIIYSX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    3.4359  -17.0660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4348  -17.8933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1495  -18.3062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1478  -16.6532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8632  -17.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8639  -17.8892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5792  -18.3002    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2942  -17.8854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5736  -16.6483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2861  -17.0564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8945  -16.5049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5580  -15.7558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7416  -15.8445    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1876  -15.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7214  -16.6537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7212  -15.8288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7201  -18.3053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9694  -17.9725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4169  -18.5852    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8288  -19.2999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6359  -19.1289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7976  -17.1656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2495  -19.6803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9681  -15.0399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4399  -14.4478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2446  -14.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4977  -13.4927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9465  -12.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1388  -13.0510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8822  -13.8378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8 10  1  0
  9  5  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  9  1  0
 13 14  1  0
  1 15  1  0
 15 16  1  0
  2 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 17  2  0
 18 22  1  0
 21 23  1  0
 12 24  2  0
 14 25  1  0
 25 26  1  0
 25 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877490

    ---

Associated Targets(Human)

BRD4 Tchem Bromodomain-containing protein 4 (13122 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.46Molecular Weight (Monoisotopic): 408.1798AlogP: 3.58#Rotatable Bonds: 4
Polar Surface Area: 95.17Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.07CX Basic pKa: 3.08CX LogP: 2.00CX LogD: 2.00
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.55Np Likeness Score: -0.84

References

1. Jones KL, Beaumont DM, Bernard SG, Bit RA, Campbell SP, Chung CW, Cutler L, Demont EH, Dennis K, Gordon L, Gray JR, Haase MV, Lewis AJ, McCleary S, Mitchell DJ, Moore SM, Parr N, Robb OJ, Smithers N, Soden PE, Suckling CJ, Taylor S, Walker AL, Watson RJ, Prinjha RK..  (2021)  Discovery of a Novel Bromodomain and Extra Terminal Domain (BET) Protein Inhibitor, I-BET282E, Suitable for Clinical Progression.,  64  (16.0): [PMID:34387088] [10.1021/acs.jmedchem.1c00855]

Source