3-(2-methoxyethyl)-2-(1-(piperazin-1-yl)butyl)quinazolin-4(3H)-one

ID: ALA4877503

PubChem CID: 148372331

Max Phase: Preclinical

Molecular Formula: C19H28N4O2

Molecular Weight: 344.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCC(c1nc2ccccc2c(=O)n1CCOC)N1CCNCC1

Standard InChI:  InChI=1S/C19H28N4O2/c1-3-6-17(22-11-9-20-10-12-22)18-21-16-8-5-4-7-15(16)19(24)23(18)13-14-25-2/h4-5,7-8,17,20H,3,6,9-14H2,1-2H3

Standard InChI Key:  LMNVFTKFDZLWND-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   23.0574   -3.5329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0563   -4.3524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7643   -4.7614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7625   -3.1240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4711   -3.5293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4700   -4.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1801   -4.7658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8959   -4.3565    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.8971   -3.5313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1824   -3.1154    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.1777   -5.5830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6058   -3.1245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3125   -3.5348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6024   -4.7671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0179   -4.7711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7267   -4.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6078   -2.3073    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.3241   -1.9030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3280   -1.0893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6231   -0.6752    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.9126   -1.0808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9070   -1.9006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3105   -4.3520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0212   -3.1279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7279   -3.5382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  7 11  2  0
  9 12  1  0
 12 13  1  0
  8 14  1  0
 14 23  1  0
 23 15  1  0
 15 16  1  0
 12 17  1  0
 17 18  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 13 24  1  0
 24 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877503

    ---

Associated Targets(Human)

CACNA2D1 Tclin Voltage-gated calcium channel alpha2/delta subunit 1 (266 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CYP3A4 Tclin Cytochrome P450 3A4 (53859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 344.46Molecular Weight (Monoisotopic): 344.2212AlogP: 1.79#Rotatable Bonds: 7
Polar Surface Area: 59.39Molecular Species: BASEHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.21CX LogP: 1.84CX LogD: 0.04
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.83Np Likeness Score: -1.20

References

1. Fernández A, Díaz JL, García M, Rodríguez-Escrich S, Lorente A, Enrech R, Dordal A, Portillo-Salido E, Porras M, Fernández B, Reinoso RF, Vela JM, Almansa C..  (2021)  Piperazinyl Bicyclic Derivatives as Selective Ligands of the α2δ-1 Subunit of Voltage-Gated Calcium Channels.,  12  (11.0): [PMID:34795870] [10.1021/acsmedchemlett.1c00416]

Source