The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1,9-dihydroxy-2,10-dimethoxy-6a,7-dihydro-4H-dibenzo[de,g]quinolin-6(5H)-yl)(3,5-dimethoxyphenyl)methanone ID: ALA4877530
PubChem CID: 164628548
Max Phase: Preclinical
Molecular Formula: C27H27NO7
Molecular Weight: 477.51
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)cc(C(=O)N2CCc3cc(OC)c(O)c4c3C2Cc2cc(O)c(OC)cc2-4)c1
Standard InChI: InChI=1S/C27H27NO7/c1-32-17-7-16(8-18(12-17)33-2)27(31)28-6-5-14-11-23(35-4)26(30)25-19-13-22(34-3)21(29)10-15(19)9-20(28)24(14)25/h7-8,10-13,20,29-30H,5-6,9H2,1-4H3
Standard InChI Key: LNXYCQXQVPHPPW-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
16.3465 -3.5246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3454 -4.3442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0516 -3.1158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7603 -3.5210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1772 -4.3437 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1783 -3.5230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4676 -3.1094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7591 -4.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0539 -4.7480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4613 -5.5603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4637 -4.7447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7561 -5.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0576 -5.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3563 -5.9581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3523 -6.7672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0554 -7.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7538 -6.7716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6385 -4.7542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6387 -3.1162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6385 -2.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0546 -7.9915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6433 -7.1736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9369 -6.7628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8822 -4.7568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8770 -5.5740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5926 -4.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2939 -4.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0037 -4.3657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0095 -3.5477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2994 -3.1347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5925 -3.5404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3018 -2.3175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0107 -1.9110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7086 -4.7792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7029 -5.5964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 9 1 0
4 3 2 0
3 1 1 0
4 8 1 0
4 7 1 0
11 5 1 0
5 6 1 0
6 7 1 0
8 9 2 0
8 11 1 0
9 13 1 0
12 10 1 0
10 11 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
2 18 1 0
1 19 1 0
19 20 1 0
16 21 1 0
15 22 1 0
22 23 1 0
5 24 1 0
24 25 2 0
24 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
30 32 1 0
32 33 1 0
28 34 1 0
34 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.51Molecular Weight (Monoisotopic): 477.1788AlogP: 4.09#Rotatable Bonds: 5Polar Surface Area: 97.69Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.30CX Basic pKa: ┄CX LogP: 3.54CX LogD: 3.54Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.57Np Likeness Score: 0.66
References 1. Chang L, Zhang Q, Tang Y, Fang Y, Dou R, Chu Y, Xia Y, Wei Z, Chen L, Dai Y.. (2021) Synthesis of norisoboldine derivatives and bioactivity assay for inducing the generation of regulatory T cells., 37 [PMID:33556569 ] [10.1016/j.bmcl.2021.127844 ]