5-Methyl-1-(1-(3-(pyridin-2-yloxy)benzyl)piperidin-4-yl)pyrimidine-2,4(1H,3H)-dione

ID: ALA4877541

PubChem CID: 164628929

Max Phase: Preclinical

Molecular Formula: C22H24N4O3

Molecular Weight: 392.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cn(C2CCN(Cc3cccc(Oc4ccccn4)c3)CC2)c(=O)[nH]c1=O

Standard InChI:  InChI=1S/C22H24N4O3/c1-16-14-26(22(28)24-21(16)27)18-8-11-25(12-9-18)15-17-5-4-6-19(13-17)29-20-7-2-3-10-23-20/h2-7,10,13-14,18H,8-9,11-12,15H2,1H3,(H,24,27,28)

Standard InChI Key:  ORAVLQYJZOTXLQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   12.5908  -10.5780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5896  -11.3976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2977  -11.8066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0073  -11.3971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0045  -10.5744    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2959  -10.1692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7157  -11.8046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4227  -11.3949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1313  -11.8049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8379  -11.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8371  -10.5778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1237  -10.1705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4201  -10.5818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5461  -11.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2533  -11.3943    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9607  -11.8074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6659  -11.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6692  -10.5840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9612  -10.1740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2499  -10.5815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3780  -10.1773    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0838  -10.5920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7905  -10.1888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7969   -9.3713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0905   -8.9586    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.3776   -9.3635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4956  -10.6020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5073   -8.9673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.6713   -8.9525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 10 14  1  0
 14 15  1  0
 15 16  1  0
 15 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 18 21  1  0
 21 22  1  0
 21 26  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 23 27  1  0
 24 28  2  0
 26 29  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4877541

    ---

Associated Targets(Human)

MRC5 (9203 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

tmk Thymidylate kinase (360 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mycobacterium tuberculosis (203094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 392.46Molecular Weight (Monoisotopic): 392.1848AlogP: 2.87#Rotatable Bonds: 5
Polar Surface Area: 80.22Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.31CX Basic pKa: 7.96CX LogP: 2.39CX LogD: 1.72
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.72Np Likeness Score: -1.36

References

1. Song L, Merceron R, Hulpia F, Lucía A, Gracia B, Jian Y, Risseeuw MDP, Verstraelen T, Cos P, Aínsa JA, Boshoff HI, Munier-Lehmann H, Savvides SN, Van Calenbergh S..  (2021)  Structure-aided optimization of non-nucleoside M. tuberculosis thymidylate kinase inhibitors.,  225  [PMID:34450493] [10.1016/j.ejmech.2021.113784]

Source