N-cyclopropyl-4-(7-(2-((trans)-3-hydroxy-3-methylcyclobutyl)ethyl)-5-(pyridin-3-yloxy)pyrazolo[1,5-a]pyrimidin-3-yl)-2-methylbenzamide

ID: ALA4877547

PubChem CID: 164628933

Max Phase: Preclinical

Molecular Formula: C29H31N5O3

Molecular Weight: 497.60

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2cnn3c(CC[C@H]4C[C@@](C)(O)C4)cc(Oc4cccnc4)nc23)ccc1C(=O)NC1CC1

Standard InChI:  InChI=1S/C29H31N5O3/c1-18-12-20(6-10-24(18)28(35)32-21-7-8-21)25-17-31-34-22(9-5-19-14-29(2,36)15-19)13-26(33-27(25)34)37-23-4-3-11-30-16-23/h3-4,6,10-13,16-17,19,21,36H,5,7-9,14-15H2,1-2H3,(H,32,35)/t19-,29+

Standard InChI Key:  QUPHQWCHLZJYPZ-CGSFZAOMSA-N

Molfile:  

 
     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
    5.1467  -10.4171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7422   -9.7114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3332  -10.4145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1564   -7.7385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1553   -8.5581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8633   -8.9670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5730   -8.5576    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8615   -7.3297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5696   -7.7340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1730   -7.1856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8379   -6.4422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0274   -6.5313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4486   -7.3301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7410   -7.7389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7412   -8.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8631   -9.7842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5707  -10.1930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9709   -7.3512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2261   -8.1287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0254   -8.2951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5703   -7.6849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3103   -6.9057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5116   -6.7430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2812   -9.0712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3707   -7.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6278   -8.6256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9138   -7.2394    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4282   -8.7907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0407   -9.3299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2058   -8.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1645   -9.1345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3202   -9.1342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5664  -11.0084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2732  -11.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9819  -11.0086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9795  -10.1872    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2722   -9.7822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  1
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  9  1  0
  8  4  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
  4 13  1  0
 13 14  1  0
 15 14  1  6
  6 16  1  0
 16 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 10 18  1  0
 20 24  1  0
 21 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 29 28  1  0
 30 29  1  0
 28 30  1  0
 15 31  1  0
 31  2  1  0
  2 32  1  0
 32 15  1  0
 17 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 17  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877547

    ---

Associated Targets(Human)

TTK Tchem Dual specificity protein kinase TTK (2978 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 497.60Molecular Weight (Monoisotopic): 497.2427AlogP: 4.88#Rotatable Bonds: 8
Polar Surface Area: 101.64Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.53CX LogP: 4.00CX LogD: 4.00
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.36Np Likeness Score: -1.06

References

1. Huang M, Huang Y, Guo J, Yu L, Chang Y, Wang X, Luo J, Huang Y, Tu Z, Lu X, Xu Y, Zhang Z, Zhang Z, Ding K..  (2021)  Pyrido[2, 3-d]pyrimidin-7(8H)-ones as new selective orally bioavailable Threonine Tyrosine Kinase (TTK) inhibitors.,  211  [PMID:33248853] [10.1016/j.ejmech.2020.113023]

Source