The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4,5-Dichloro-6-oxopyridazin-1(6H)-yl)-N-(5-methyl-6-(N-(2-(pyridin-2-yl)ethyl)sulfamoyl)pyridin-2-yl]acetamide ID: ALA4877617
PubChem CID: 162727846
Max Phase: Preclinical
Molecular Formula: C19H18Cl2N6O4S
Molecular Weight: 497.36
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=O)Cn2ncc(Cl)c(Cl)c2=O)nc1S(=O)(=O)NCCc1ccccn1
Standard InChI: InChI=1S/C19H18Cl2N6O4S/c1-12-5-6-15(25-16(28)11-27-19(29)17(21)14(20)10-23-27)26-18(12)32(30,31)24-9-7-13-4-2-3-8-22-13/h2-6,8,10,24H,7,9,11H2,1H3,(H,25,26,28)
Standard InChI Key: KASYJIBCHCEKAR-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
21.3228 -26.9888 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7394 -26.2763 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.9140 -26.2718 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4544 -26.6888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4533 -27.5160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1680 -27.9289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8844 -27.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8816 -26.6851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1663 -26.2760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7398 -25.4516 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5944 -26.2700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3104 -26.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0231 -26.2646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3135 -27.5046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7391 -26.6743 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7391 -27.4981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.4542 -27.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1680 -27.4926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1623 -26.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4466 -26.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4398 -25.4326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8736 -26.2458 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
28.8845 -27.9014 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
22.4544 -25.0395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4548 -24.2146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1695 -23.8026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8818 -24.2189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5960 -23.8075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5969 -22.9818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8777 -22.5690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1665 -22.9828 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7385 -27.9279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
4 2 1 0
2 10 1 0
8 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 15 1 0
20 21 2 0
19 22 1 0
18 23 1 0
10 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
5 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.36Molecular Weight (Monoisotopic): 496.0487AlogP: 1.81#Rotatable Bonds: 8Polar Surface Area: 135.94Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.97CX Basic pKa: 4.54CX LogP: 2.04CX LogD: 2.03Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -2.37
References 1. McKinney DC, McMillan BJ, Ranaghan MJ, Moroco JA, Brousseau M, Mullin-Bernstein Z, O'Keefe M, McCarren P, Mesleh MF, Mulvaney KM, Robinson F, Singh R, Bajrami B, Wagner FF, Hilgraf R, Drysdale MJ, Campbell AJ, Skepner A, Timm DE, Porter D, Kaushik VK, Sellers WR, Ianari A.. (2021) Discovery of a First-in-Class Inhibitor of the PRMT5-Substrate Adaptor Interaction., 64 (15.0): [PMID:34342224 ] [10.1021/acs.jmedchem.1c00507 ]