3-(3-(4-(4-(3,5-difluoro-2-oxopyridin-1(2H)-yl)phenyl)piperazin-1-yl)propyl)-1H-indole-5-carbonitrile

ID: ALA4877630

PubChem CID: 164626850

Max Phase: Preclinical

Molecular Formula: C27H26FN5O

Molecular Weight: 455.54

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1ccc2[nH]cc(CCCN3CCN(c4ccc(-n5cc(F)ccc5=O)cc4)CC3)c2c1

Standard InChI:  InChI=1S/C27H26FN5O/c28-22-4-10-27(34)33(19-22)24-7-5-23(6-8-24)32-14-12-31(13-15-32)11-1-2-21-18-30-26-9-3-20(17-29)16-25(21)26/h3-10,16,18-19,30H,1-2,11-15H2

Standard InChI Key:  UTZLFGZACXWOPC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    4.3126  -23.1953    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0640  -22.8650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9800  -22.0463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1734  -21.8756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7648  -21.1665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9434  -21.1665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5307  -21.8756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9434  -22.5888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7648  -22.5888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5307  -20.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1221  -19.7442    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5906  -21.4985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3719  -21.7532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9825  -21.2012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7639  -21.4559    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9347  -22.2584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7160  -22.5172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3266  -21.9652    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1517  -21.1627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3704  -20.9080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1080  -22.2158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2787  -23.0183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0601  -23.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6665  -22.7251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4958  -21.9226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7144  -21.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6228  -23.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4041  -24.0370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0106  -23.4891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8398  -22.6866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0585  -22.4278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4479  -22.9798    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8901  -21.6282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5743  -24.8362    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  1  9  1  0
  4  9  2  0
 10 11  3  0
  6 10  1  0
 12 13  1  0
 13 14  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 15 20  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 21 26  2  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
 27 32  1  0
 24 32  1  0
 18 21  1  0
 14 15  1  0
  3 12  1  0
 31 33  2  0
 28 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877630

    ---

Associated Targets(non-human)

Slc6a4 Serotonin transporter (6087 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 455.54Molecular Weight (Monoisotopic): 455.2121AlogP: 4.08#Rotatable Bonds: 6
Polar Surface Area: 68.06Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.57CX LogP: 4.31CX LogD: 3.11
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.48Np Likeness Score: -1.41

References

1. Xu T, Xue Y, Lu J, Jin C..  (2021)  Synthesis and biological evaluation of 1-(4-(piperazin-1-yl)phenyl)pyridin-2(1H)-one derivatives as potential SSRIs.,  223  [PMID:34182358] [10.1016/j.ejmech.2021.113644]

Source