2-(6,8-diiodo-4-oxo-3-(4-sulfamoylphenyl)-3,4-dihydroquinazolin-2-ylthio)-N-(3-fluorophenyl)acetamide

ID: ALA4877648

PubChem CID: 164626860

Max Phase: Preclinical

Molecular Formula: C22H15FI2N4O4S2

Molecular Weight: 736.33

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NS(=O)(=O)c1ccc(-n2c(SCC(=O)Nc3cccc(F)c3)nc3c(I)cc(I)cc3c2=O)cc1

Standard InChI:  InChI=1S/C22H15FI2N4O4S2/c23-12-2-1-3-14(8-12)27-19(30)11-34-22-28-20-17(9-13(24)10-18(20)25)21(31)29(22)15-4-6-16(7-5-15)35(26,32)33/h1-10H,11H2,(H,27,30)(H2,26,32,33)

Standard InChI Key:  OKJSAELKPJUYPS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   18.9316   -1.1020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3443   -1.8119    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.7527   -1.0995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6721   -3.4379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6709   -4.2575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3790   -4.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3772   -3.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0858   -3.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0846   -4.2595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7947   -4.6709    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5106   -4.2616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5118   -3.4364    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7971   -3.0205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9643   -3.0295    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   14.3787   -5.4836    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   15.7971   -2.2033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2188   -3.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9257   -3.4441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6340   -3.0380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6364   -2.2199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9247   -1.8097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2194   -2.2183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2171   -4.6722    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.0518   -2.2215    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9260   -4.2656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6325   -4.6762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3414   -4.2696    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6302   -5.4934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0479   -4.6802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0409   -5.4944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7466   -5.9049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4565   -5.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4561   -4.6768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7498   -4.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1636   -4.2677    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
  4 14  1  0
  6 15  1  0
 13 16  2  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 12 17  1  0
 11 23  1  0
 20  2  1  0
  2 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 33 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877648

    ---

Associated Targets(non-human)

Nfe2l2 Nuclear factor erythroid 2-related factor 2 (714 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 736.33Molecular Weight (Monoisotopic): 735.8608AlogP: 4.11#Rotatable Bonds: 6
Polar Surface Area: 124.15Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.12CX Basic pKa: CX LogP: 5.24CX LogD: 5.24
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.17Np Likeness Score: -2.38

References

1. Soliman AM, Mekkawy MH, Karam HM, Higgins M, Dinkova-Kostova AT, Ghorab MM..  (2021)  Novel iodinated quinazolinones bearing sulfonamide as new scaffold targeting radiation induced oxidative stress.,  42  [PMID:33811990] [10.1016/j.bmcl.2021.128002]

Source