7-(1-acryloylpiperidin-4-yl)-1-amino-2-(4-phenoxyphenyl)-1H-imidazo[1,2-b]pyrazole-3-carboxamide

ID: ALA4877720

PubChem CID: 164628044

Max Phase: Preclinical

Molecular Formula: C26H26N6O3

Molecular Weight: 470.53

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CC(=O)N1CCC(c2cnn3c(C(N)=O)c(-c4ccc(Oc5ccccc5)cc4)n(N)c23)CC1

Standard InChI:  InChI=1S/C26H26N6O3/c1-2-22(33)30-14-12-17(13-15-30)21-16-29-32-24(25(27)34)23(31(28)26(21)32)18-8-10-20(11-9-18)35-19-6-4-3-5-7-19/h2-11,16-17H,1,12-15,28H2,(H2,27,34)

Standard InChI Key:  WNFOHBOJEDUNQG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   14.9868   -3.4882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2427   -2.7026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5757   -2.2175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1604   -3.4882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9059   -2.7054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0824   -2.7070    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8266   -3.4908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4943   -3.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4948   -4.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7775   -5.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7771   -6.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4922   -6.4488    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2095   -6.0334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2115   -5.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4907   -7.2752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5742   -1.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8572   -0.9772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2855   -0.9746    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0254   -2.4482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6398   -3.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4257   -2.7485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5984   -1.9397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9790   -1.3877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1997   -1.6431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3845   -1.6856    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9996   -2.2399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8248   -3.0469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4349   -3.5969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2220   -3.3429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3955   -2.5299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7798   -1.9793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7779   -7.6850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2020   -7.6876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2005   -8.5099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4698   -4.1536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  4  1  1  0
  1  2  1  0
  2  3  2  0
  3  5  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  4  2  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  8  9  1  0
 12 15  1  0
  3 16  1  0
 16 17  2  0
 16 18  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
  2 19  1  0
 22 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 15 32  2  0
 15 33  1  0
 33 34  2  0
  1 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877720

    ---

Associated Targets(Human)

BTK Tclin Tyrosine-protein kinase BTK (8973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 470.53Molecular Weight (Monoisotopic): 470.2066AlogP: 3.30#Rotatable Bonds: 6
Polar Surface Area: 120.88Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.85CX LogP: 2.21CX LogD: 2.21
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -0.84

References

1. Zhang D, Xu G, Zhao J, Wang Y, Wu X, He X, Li W, Zhang S, Yang S, Ma C, Jiang Y, Ding Q..  (2021)  Structure-activity relationship investigation for imidazopyrazole-3-carboxamide derivatives as novel selective inhibitors of Bruton's tyrosine kinase.,  225  [PMID:34391034] [10.1016/j.ejmech.2021.113724]

Source