7-(1-acryloylpyrrolidin-3-yl)-2-(4-(4-methoxyphenoxy)phenyl)-1H-imidazo[1,2-b]pyrazole-3-carboxamide

ID: ALA4877739

PubChem CID: 164628288

Max Phase: Preclinical

Molecular Formula: C26H25N5O4

Molecular Weight: 471.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CC(=O)N1CCC(c2cnn3c(C(N)=O)c(-c4ccc(Oc5ccc(OC)cc5)cc4)[nH]c23)C1

Standard InChI:  InChI=1S/C26H25N5O4/c1-3-22(32)30-13-12-17(15-30)21-14-28-31-24(25(27)33)23(29-26(21)31)16-4-6-19(7-5-16)35-20-10-8-18(34-2)9-11-20/h3-11,14,17,29H,1,12-13,15H2,2H3,(H2,27,33)

Standard InChI Key:  DWIOSNYCLYYCBO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   12.5973  -24.9162    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8534  -24.1298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1858  -23.6443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7702  -24.9162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5153  -24.1327    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6913  -24.1342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4351  -24.9187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1036  -25.4035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1039  -26.2261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1843  -22.8173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4667  -22.4030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8961  -22.4003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6368  -23.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2517  -24.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0381  -24.1758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2110  -23.3662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5911  -22.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8111  -23.0694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9978  -23.1119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6135  -23.6668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4384  -24.4744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0491  -25.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8369  -24.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0105  -23.9570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3943  -23.4059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4352  -26.7077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6898  -27.4900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5125  -27.4897    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7663  -26.7071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9965  -28.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6621  -28.9071    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8149  -28.0687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2988  -28.7342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4477  -25.3223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2755  -26.1270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  1  1  0
  1  2  1  0
  2  3  2  0
  3  5  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  4  2  0
  8  9  1  0
  3 10  1  0
 10 11  2  0
 10 12  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  2 13  1  0
 16 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  9 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29  9  1  0
 28 30  1  0
 30 31  2  0
 30 32  1  0
 32 33  2  0
 23 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877739

    ---

Associated Targets(Human)

BTK Tclin Tyrosine-protein kinase BTK (8973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 471.52Molecular Weight (Monoisotopic): 471.1907AlogP: 3.73#Rotatable Bonds: 7
Polar Surface Area: 114.95Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.95CX Basic pKa: 0.26CX LogP: 2.65CX LogD: 2.65
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: -0.74

References

1. Zhang D, Xu G, Zhao J, Wang Y, Wu X, He X, Li W, Zhang S, Yang S, Ma C, Jiang Y, Ding Q..  (2021)  Structure-activity relationship investigation for imidazopyrazole-3-carboxamide derivatives as novel selective inhibitors of Bruton's tyrosine kinase.,  225  [PMID:34391034] [10.1016/j.ejmech.2021.113724]

Source