The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-(1,1-Difluoroallyl)-1-(7-ethyl-7-hydroxy-6,7-dihydro-5H-cyclopenta[b]Pyridin-2-yl)-6-((4-(4-methylpiperazin-1-yl)phenyl)-amino)-1,2-dihydro-3H-pyrazolo[3,4-d]pyrimidin-3-one ID: ALA4877772
PubChem CID: 164628963
Max Phase: Preclinical
Molecular Formula: C29H32F2N8O2
Molecular Weight: 562.63
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(F)(F)n1c(=O)c2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc2n1-c1ccc2c(n1)[C@@](O)(CC)CC2
Standard InChI: InChI=1S/C29H32F2N8O2/c1-4-28(41)13-12-19-6-11-23(34-24(19)28)38-25-22(26(40)39(38)29(30,31)5-2)18-32-27(35-25)33-20-7-9-21(10-8-20)37-16-14-36(3)15-17-37/h5-11,18,41H,2,4,12-17H2,1,3H3,(H,32,33,35)/t28-/m1/s1
Standard InChI Key: AKMNSYGSPBSLNS-MUUNZHRXSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
24.3099 -22.0148 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.5974 -21.6006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5964 -22.4233 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.7739 -23.6223 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.3637 -24.3347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1838 -24.3301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0881 -19.9517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0881 -20.7762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8043 -21.1862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5164 -20.7762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5164 -19.9517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8043 -19.5374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2302 -21.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2259 -22.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9390 -22.4270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6510 -22.0178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6496 -21.1891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9400 -20.7777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3655 -22.4281 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0800 -22.0179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7913 -22.4295 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7865 -20.7806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0753 -21.1964 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5060 -21.1948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5066 -22.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2918 -22.2729 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.7738 -21.6043 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2907 -20.9364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5435 -20.1519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0119 -20.8887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8363 -20.8880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5458 -23.0538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9915 -23.6678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2492 -24.4514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3494 -23.2218 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6059 -24.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0590 -24.6211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4768 -25.3363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2861 -25.1599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6022 -25.0423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3737 -19.5370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 6
6 5 1 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
10 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
19 20 1 0
20 21 2 0
21 25 1 0
24 22 1 0
22 23 2 0
23 20 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 28 1 0
28 24 1 0
28 29 2 0
27 2 1 0
2 30 1 0
30 31 2 0
32 33 2 0
33 34 1 0
34 37 2 0
36 35 2 0
35 32 1 0
26 32 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 5 1 0
5 36 1 0
6 40 1 0
7 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 562.63Molecular Weight (Monoisotopic): 562.2616AlogP: 3.75#Rotatable Bonds: 7Polar Surface Area: 104.34Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.35CX Basic pKa: 7.96CX LogP: 4.63CX LogD: 3.97Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.33Np Likeness Score: -0.79
References 1. Huang PQ, Boren BC, Hegde SG, Liu H, Unni AK, Abraham S, Hopkins CD, Paliwal S, Samatar AA, Li J, Bunker KD.. (2021) Discovery of ZN-c3, a Highly Potent and Selective Wee1 Inhibitor Undergoing Evaluation in Clinical Trials for the Treatment of Cancer., 64 (17.0): [PMID:34423975 ] [10.1021/acs.jmedchem.1c01121 ]