3-Chloro-N-(2-((2-oxo-2-(((S)-1-phenylethyl)amino)ethyl)thio)benzo[d]thiazol-6-yl)-4-(pentan-2-yloxy)benzamide

ID: ALA4877798

PubChem CID: 164625796

Max Phase: Preclinical

Molecular Formula: C29H30ClN3O3S2

Molecular Weight: 568.16

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCC(C)Oc1ccc(C(=O)Nc2ccc3nc(SCC(=O)N[C@@H](C)c4ccccc4)sc3c2)cc1Cl

Standard InChI:  InChI=1S/C29H30ClN3O3S2/c1-4-8-18(2)36-25-14-11-21(15-23(25)30)28(35)32-22-12-13-24-26(16-22)38-29(33-24)37-17-27(34)31-19(3)20-9-6-5-7-10-20/h5-7,9-16,18-19H,4,8,17H2,1-3H3,(H,31,34)(H,32,35)/t18?,19-/m0/s1

Standard InChI Key:  DNVFKXQXZVMLEH-GGYWPGCISA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   21.1890  -12.0922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1879  -12.9209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9002  -13.3365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6184  -12.9204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6156  -12.0886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8984  -11.6808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8960  -10.8545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6109  -10.4370    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1827  -10.4414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3284  -10.8502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0434  -10.4328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7607  -10.8459    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   25.4757  -10.4286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2286  -10.7615    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   25.5558   -9.6031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3636   -9.4297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7726  -10.1450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5952  -10.1454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0100   -9.4313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5918   -8.7152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7705   -8.7183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8363   -9.4303    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2483  -10.1460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0746  -10.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4871  -10.8636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3127  -10.8630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7237  -10.1457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3074   -9.4277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4831   -9.4319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5501  -10.1436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3308  -11.6766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8381  -10.8627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9630  -10.8547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7853  -10.8526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5538  -11.5677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1982  -11.5636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0203  -11.5615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7174   -8.7118    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  6
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 17  1  0
 16 15  1  0
 15 13  2  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
 10 31  2  0
 23 32  2  0
 30 33  1  0
 33 34  1  0
 33 35  1  0
 34 36  1  0
 36 37  1  0
 28 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877798

    ---

Associated Targets(Human)

STAT3 Tchem Signal transducer and activator of transcription 3 (3313 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 568.16Molecular Weight (Monoisotopic): 567.1417AlogP: 7.74#Rotatable Bonds: 11
Polar Surface Area: 80.32Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.59CX Basic pKa: 1.07CX LogP: 7.43CX LogD: 7.43
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.18Np Likeness Score: -2.05

References

1. Gao D, Jin N, Fu Y, Zhu Y, Wang Y, Wang T, Chen Y, Zhang M, Xiao Q, Huang M, Li Y..  (2021)  Rational drug design of benzothiazole-based derivatives as potent signal transducer and activator of transcription 3 (STAT3) signaling pathway inhibitors.,  216  [PMID:33689932] [10.1016/j.ejmech.2021.113333]

Source