The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
allyl N-[(7S)-1,2,3-trimethoxy-10-(methylamino)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamate ID: ALA4877808
PubChem CID: 164626036
Max Phase: Preclinical
Molecular Formula: C24H28N2O6
Molecular Weight: 440.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CCOC(=O)N[C@H]1CCc2cc(OC)c(OC)c(OC)c2-c2ccc(NC)c(=O)cc21
Standard InChI: InChI=1S/C24H28N2O6/c1-6-11-32-24(28)26-17-9-7-14-12-20(29-3)22(30-4)23(31-5)21(14)15-8-10-18(25-2)19(27)13-16(15)17/h6,8,10,12-13,17H,1,7,9,11H2,2-5H3,(H,25,27)(H,26,28)/t17-/m0/s1
Standard InChI Key: WHXQVNOLWRGICZ-KRWDZBQOSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
39.5168 -12.7201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5157 -13.5355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2196 -13.9445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2178 -12.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9257 -13.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9264 -12.7165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5683 -12.2027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3695 -12.3771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7226 -13.1207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5683 -14.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3718 -13.8636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0210 -14.3778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2076 -14.7950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0262 -15.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5712 -15.5408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3802 -15.7178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5638 -16.5099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.9659 -17.0671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7593 -15.5571 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.5356 -13.1189 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.2204 -14.7575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.8117 -13.9435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.8131 -12.3158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.8129 -11.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1085 -13.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5173 -15.1627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9427 -12.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7598 -12.4085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.5325 -11.7035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.1700 -13.1153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.9872 -13.1135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.3973 -13.8203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 5 2 0
6 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
5 10 1 0
7 8 1 0
8 9 1 0
11 9 1 0
10 11 1 0
11 12 2 0
10 13 2 0
12 14 1 0
13 15 1 0
14 16 1 0
15 16 2 0
16 17 1 0
17 18 1 0
14 19 2 0
9 20 1 6
3 21 1 0
2 22 1 0
1 23 1 0
23 24 1 0
22 25 1 0
21 26 1 0
20 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
30 31 1 0
31 32 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 440.50Molecular Weight (Monoisotopic): 440.1947AlogP: 3.68#Rotatable Bonds: 7Polar Surface Area: 95.12Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.86CX Basic pKa: 3.80CX LogP: 2.50CX LogD: 2.49Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.63Np Likeness Score: 0.48
References 1. Krzywik J, Aminpour M, Janczak J, Maj E, Moshari M, Mozga W, Wietrzyk J, Tuszyński JA, Huczyński A.. (2021) An insight into the anticancer potential of carbamates and thiocarbamates of 10-demethoxy-10-methylaminocolchicine., 215 [PMID:33611191 ] [10.1016/j.ejmech.2021.113282 ]