N-((2S,3R)-3-hydroxy-4-(N-isobutyl-4-methoxyphenylsulfonamido)-1-phenylbutan-2-yl)piperidine-4-carboxamide

ID: ALA4877811

PubChem CID: 164626038

Max Phase: Preclinical

Molecular Formula: C27H39N3O5S

Molecular Weight: 517.69

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)C2CCNCC2)cc1

Standard InChI:  InChI=1S/C27H39N3O5S/c1-20(2)18-30(36(33,34)24-11-9-23(35-3)10-12-24)19-26(31)25(17-21-7-5-4-6-8-21)29-27(32)22-13-15-28-16-14-22/h4-12,20,22,25-26,28,31H,13-19H2,1-3H3,(H,29,32)/t25-,26+/m0/s1

Standard InChI Key:  NTOMRLCGHVNSKO-IZZNHLLZSA-N

Molfile:  

 
     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
    7.3341  -23.1042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7468  -23.8141    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.1552  -23.1017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3496  -24.2103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3496  -25.0316    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0590  -25.4402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7684  -25.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7684  -24.2103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0590  -23.7976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4814  -23.8038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4838  -22.9825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1880  -24.2145    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9010  -23.8080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6116  -24.2186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9034  -22.9866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6164  -22.5760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3269  -22.9930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0395  -22.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0423  -21.7609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3267  -21.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6171  -21.7586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6092  -25.0399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3246  -23.8121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0353  -24.2228    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0329  -25.0441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4590  -24.2269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4515  -25.0492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1613  -25.4639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8712  -25.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8710  -24.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1647  -23.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6201  -25.7498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8029  -25.7451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0246  -26.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5792  -25.4614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5796  -26.2786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  1  1
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 14 22  1  1
 14 23  1  0
 23 24  1  0
 24 25  1  0
 24  2  1  0
  2 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 25 32  1  0
 32 33  1  0
 32 34  1  0
 29 35  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877811

    ---

Associated Targets(Human)

HEK-293T (167025 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

pol Human immunodeficiency virus type 1 protease (9113 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Human immunodeficiency virus 1 (70413 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 517.69Molecular Weight (Monoisotopic): 517.2610AlogP: 2.43#Rotatable Bonds: 12
Polar Surface Area: 107.97Molecular Species: BASEHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.79CX Basic pKa: 10.17CX LogP: 2.68CX LogD: 0.04
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.40Np Likeness Score: -0.61

References

1. Zhu M, Zhou H, Ma L, Dong B, Zhou J, Zhang G, Wang M, Wang J, Cen S, Wang Y..  (2021)  Design and evaluation of novel piperidine HIV-1 protease inhibitors with potency against DRV-resistant variants.,  220  [PMID:33906049] [10.1016/j.ejmech.2021.113450]

Source