The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((1-((6-bromo-2-chloroquinolin-3-yl)methyl)-1H-1,2,3-triazol-4-yl)methyl)-1-(4-methoxyphenyl)-1H-1,2,4-triazol-5(4H)-one ID: ALA4877837
PubChem CID: 164626615
Max Phase: Preclinical
Molecular Formula: C22H17BrClN7O2
Molecular Weight: 526.78
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-n2ncn(Cc3cn(Cc4cc5cc(Br)ccc5nc4Cl)nn3)c2=O)cc1
Standard InChI: InChI=1S/C22H17BrClN7O2/c1-33-19-5-3-18(4-6-19)31-22(32)29(13-25-31)11-17-12-30(28-27-17)10-15-8-14-9-16(23)2-7-20(14)26-21(15)24/h2-9,12-13H,10-11H2,1H3
Standard InChI Key: ZLFRVSIDOCJVQA-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
8.6410 -19.4144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6399 -20.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3479 -20.6429 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3461 -19.0056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0547 -19.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0555 -20.2299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7640 -20.6369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4723 -20.2261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4676 -19.4040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7584 -19.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9284 -20.6403 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.9332 -19.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2256 -19.4148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4818 -19.0842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9351 -19.6916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3439 -20.3993 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1432 -20.2291 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1224 -19.6064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6422 -20.2677 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8287 -20.2711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5763 -21.0484 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2376 -21.5286 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8985 -21.0480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3468 -19.6111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7992 -21.3011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1938 -20.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4172 -21.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2469 -21.8036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8592 -22.3511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6334 -22.0960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4667 -22.0552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2951 -22.8541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1743 -18.9928 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 6 1 0
5 4 1 0
4 1 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 2 0
2 11 1 0
1 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 13 1 0
15 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 19 1 0
20 24 2 0
21 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
31 32 1 0
9 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.78Molecular Weight (Monoisotopic): 525.0316AlogP: 3.69#Rotatable Bonds: 6Polar Surface Area: 92.65Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 0.19CX LogP: 4.67CX LogD: 4.67Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: -1.75
References 1. Nesaragi AR, Kamble RR, Bayannavar PK, Shaikh SKJ, Hoolageri SR, Kodasi B, Joshi SD, Kumbar VM.. (2021) Microwave assisted regioselective synthesis of quinoline appended triazoles as potent anti-tubercular and antifungal agents via copper (I) catalyzed cycloaddition., 41 [PMID:33766768 ] [10.1016/j.bmcl.2021.127984 ]