The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1,9-dihydroxy-2,10-dimethoxy-6a,7-dihydro-4H-dibenzo[de,g]quinolin-6(5H)-yl)(3,4,5-trimethoxyphenyl)methanone ID: ALA4877840
PubChem CID: 164626616
Max Phase: Preclinical
Molecular Formula: C28H29NO8
Molecular Weight: 507.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1O)CC1c3c(cc(OC)c(O)c3-2)CCN1C(=O)c1cc(OC)c(OC)c(OC)c1
Standard InChI: InChI=1S/C28H29NO8/c1-33-20-13-17-15(9-19(20)30)8-18-24-14(10-21(34-2)26(31)25(17)24)6-7-29(18)28(32)16-11-22(35-3)27(37-5)23(12-16)36-4/h9-13,18,30-31H,6-8H2,1-5H3
Standard InChI Key: KPYVRVGYZSYNBF-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
5.4300 -15.6256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4289 -16.4452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1351 -15.2168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8437 -15.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2607 -16.4447 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2618 -15.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5511 -15.2105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8426 -16.4427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1373 -16.8491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5448 -17.6614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5471 -16.8458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8395 -18.0677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1411 -17.6588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4398 -18.0591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4358 -18.8682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1389 -19.2753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8373 -18.8727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7220 -16.8552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7222 -15.2172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7220 -14.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1381 -20.0925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7268 -19.2746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0204 -18.8638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9657 -16.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9604 -17.6750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6761 -16.4538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3774 -16.8701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0872 -16.4668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0930 -15.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3829 -15.2357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6760 -15.6414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3853 -14.4185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0942 -14.0120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8027 -15.2438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5084 -15.6560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7921 -16.8803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7864 -17.6974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 9 1 0
4 3 2 0
3 1 1 0
4 8 1 0
4 7 1 0
11 5 1 0
5 6 1 0
6 7 1 0
8 9 2 0
8 11 1 0
9 13 1 0
12 10 1 0
10 11 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
2 18 1 0
1 19 1 0
19 20 1 0
16 21 1 0
15 22 1 0
22 23 1 0
5 24 1 0
24 25 2 0
24 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
30 32 1 0
32 33 1 0
29 34 1 0
34 35 1 0
28 36 1 0
36 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 507.54Molecular Weight (Monoisotopic): 507.1893AlogP: 4.10#Rotatable Bonds: 6Polar Surface Area: 106.92Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.30CX Basic pKa: ┄CX LogP: 3.39CX LogD: 3.38Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.51Np Likeness Score: 0.75
References 1. Chang L, Zhang Q, Tang Y, Fang Y, Dou R, Chu Y, Xia Y, Wei Z, Chen L, Dai Y.. (2021) Synthesis of norisoboldine derivatives and bioactivity assay for inducing the generation of regulatory T cells., 37 [PMID:33556569 ] [10.1016/j.bmcl.2021.127844 ]