The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-((3-(but-2-Ynamido)benzyl)amino)-7-((3,5-dimethoxyphenyl)amino)imidazo[1,2-c]pyrimidine-8-carboxamide ID: ALA4877887
PubChem CID: 164627084
Max Phase: Preclinical
Molecular Formula: C26H25N7O4
Molecular Weight: 499.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC#CC(=O)Nc1cccc(CNc2nc(Nc3cc(OC)cc(OC)c3)c(C(N)=O)c3nccn23)c1
Standard InChI: InChI=1S/C26H25N7O4/c1-4-6-21(34)30-17-8-5-7-16(11-17)15-29-26-32-24(22(23(27)35)25-28-9-10-33(25)26)31-18-12-19(36-2)14-20(13-18)37-3/h5,7-14,31H,15H2,1-3H3,(H2,27,35)(H,29,32)(H,30,34)
Standard InChI Key: DEIBRWFGIYKTLK-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
37.1218 -19.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1218 -20.0255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8338 -20.4338 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.5458 -20.0255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8338 -18.7838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5428 -19.1987 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.1565 -18.6527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8268 -17.9003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0094 -17.9813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.2605 -20.4377 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.2609 -21.2628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9755 -21.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4061 -18.7900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4037 -17.9651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.6928 -19.2046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.4079 -20.4391 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4091 -21.2641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6938 -21.6754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6946 -22.4996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4103 -22.9119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1265 -22.4940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1222 -21.6711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8431 -22.9029 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.8472 -23.7279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9806 -22.9128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.9814 -23.7379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9735 -22.4975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6874 -22.9096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4027 -22.4968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3997 -21.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6853 -21.2590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1125 -21.2522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.8286 -21.6619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5415 -21.2465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8319 -22.4869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.2511 -20.8297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9625 -20.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 5 1 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
4 10 1 0
10 11 1 0
11 12 1 0
1 13 1 0
13 14 1 0
13 15 2 0
2 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
21 23 1 0
23 24 1 0
19 25 1 0
25 26 1 0
12 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 12 1 0
30 32 1 0
32 33 1 0
33 34 1 0
33 35 2 0
34 36 3 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.53Molecular Weight (Monoisotopic): 499.1968AlogP: 3.16#Rotatable Bonds: 9Polar Surface Area: 144.90Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.19CX Basic pKa: 5.10CX LogP: 3.79CX LogD: 3.79Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: -0.99
References 1. Rao D, Li H, Ren X, Sun Y, Wen C, Zheng M, Huang H, Tang W, Xu S.. (2021) Discovery of a potent, selective, and covalent ZAP-70 kinase inhibitor., 219 [PMID:33845236 ] [10.1016/j.ejmech.2021.113393 ]