The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ent-16-alpha-hydroxy-15-beta-(tosyloxy)methylbeyeran-19-oic acid ID: ALA4877903
PubChem CID: 164628050
Max Phase: Preclinical
Molecular Formula: C28H40O6S
Molecular Weight: 504.69
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(S(=O)(=O)OC[C@@H]2[C@@H](O)[C@@]3(C)CC[C@H]4[C@]5(C)CCC[C@@](C)(C(=O)O)[C@H]5CC[C@@]24C3)cc1
Standard InChI: InChI=1S/C28H40O6S/c1-18-6-8-19(9-7-18)35(32,33)34-16-20-23(29)25(2)14-10-22-26(3)12-5-13-27(4,24(30)31)21(26)11-15-28(20,22)17-25/h6-9,20-23,29H,5,10-17H2,1-4H3,(H,30,31)/t20-,21+,22+,23-,25+,26-,27-,28-/m1/s1
Standard InChI Key: FTIHLUMNFDAVTQ-JVDMJLNVSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
12.3452 -10.2552 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.0667 -10.6338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0365 -9.8171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8413 -9.7072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4334 -10.4154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2506 -10.4145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1360 -8.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1360 -9.3028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8413 -8.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5465 -8.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5431 -9.3028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2451 -9.7121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9552 -9.3088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2521 -8.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9587 -8.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6706 -8.0960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6821 -7.2754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9755 -6.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2574 -7.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8428 -11.1227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0678 -10.4136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8294 -8.8901 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.2450 -8.8942 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.3949 -6.8758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5392 -7.6684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6606 -8.9024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3870 -7.6808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1775 -7.4737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0942 -9.5932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9108 -9.5630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9630 -10.9775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1469 -11.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7648 -11.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1993 -12.4206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0200 -12.3877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3985 -11.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8180 -13.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
1 3 2 0
4 5 1 1
4 6 1 0
7 8 1 0
7 9 1 0
8 4 1 0
4 11 1 0
10 9 1 0
10 11 1 0
10 14 1 0
11 12 1 0
12 13 1 0
13 15 1 0
14 15 1 0
14 19 1 0
15 16 1 1
16 17 1 0
17 18 1 0
18 19 1 0
6 20 1 0
6 21 2 0
11 22 1 1
14 23 1 1
17 24 1 1
10 25 1 6
15 26 1 0
17 27 1 0
26 27 1 0
27 28 1 6
26 29 1 1
29 30 1 0
30 1 1 0
1 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
34 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.69Molecular Weight (Monoisotopic): 504.2546AlogP: 5.17#Rotatable Bonds: 5Polar Surface Area: 100.90Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.36CX Basic pKa: ┄CX LogP: 5.47CX LogD: 2.56Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.54Np Likeness Score: 1.43
References 1. Zhang H, Liu B, Xu G, Xu C, Ou E, Liu J, Sun X, Zhao Y.. (2021) Synthesis and in vivo screening of isosteviol derivatives as new cardioprotective agents., 219 [PMID:33862515 ] [10.1016/j.ejmech.2021.113396 ]