N-(5,6-Dihydroxybenzo[d]thiazol-2-yl)-2,2-bis-(4-chlorophenyl)acetamide

ID: ALA4877937

PubChem CID: 164628555

Max Phase: Preclinical

Molecular Formula: C21H14Cl2N2O3S

Molecular Weight: 445.33

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1nc2cc(O)c(O)cc2s1)C(c1ccc(Cl)cc1)c1ccc(Cl)cc1

Standard InChI:  InChI=1S/C21H14Cl2N2O3S/c22-13-5-1-11(2-6-13)19(12-3-7-14(23)8-4-12)20(28)25-21-24-15-9-16(26)17(27)10-18(15)29-21/h1-10,19,26-27H,(H,24,25,28)

Standard InChI Key:  VHZRMIJXJMVSNK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   23.2003   -3.8103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1992   -4.6369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9138   -5.0514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9121   -3.4001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6232   -3.8067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6234   -4.6324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4089   -4.8901    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.8958   -4.2211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4085   -3.5527    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   22.4859   -3.4005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.4845   -5.0504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7200   -4.2208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.1297   -3.5064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9539   -3.5061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7195   -2.7923    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3684   -4.2203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3679   -2.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1972   -2.7956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6110   -2.0819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1965   -1.3668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3681   -1.3722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9579   -2.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9519   -4.9298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3657   -5.6435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1907   -5.6437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6003   -4.9242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1883   -4.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5966   -6.3492    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   29.6084   -0.6512    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  1 10  1  0
  2 11  1  0
  8 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 14 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 16 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 16  1  0
 25 28  1  0
 20 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877937

    ---

Associated Targets(non-human)

NS3 Genome polyprotein (385 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Dengue virus type 2 NS3 protein (2214 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 445.33Molecular Weight (Monoisotopic): 444.0102AlogP: 5.78#Rotatable Bonds: 4
Polar Surface Area: 82.45Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.68CX Basic pKa: 0.17CX LogP: 6.15CX LogD: 5.96
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.35Np Likeness Score: -1.24

References

1. Maus H, Barthels F, Hammerschmidt SJ, Kopp K, Millies B, Gellert A, Ruggieri A, Schirmeister T..  (2021)  SAR of novel benzothiazoles targeting an allosteric pocket of DENV and ZIKV NS2B/NS3 proteases.,  47  [PMID:34509861] [10.1016/j.bmc.2021.116392]

Source