Elegansol A

ID: ALA4877941

PubChem CID: 164628558

Max Phase: Preclinical

Molecular Formula: C20H36O2

Molecular Weight: 308.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)[C@@]1(O)CC[C@H]2C(CC[C@H]3C(C)(C)CCC[C@]23C)[C@@H]1O

Standard InChI:  InChI=1S/C20H36O2/c1-13(2)20(22)12-9-15-14(17(20)21)7-8-16-18(3,4)10-6-11-19(15,16)5/h13-17,21-22H,6-12H2,1-5H3/t14?,15-,16-,17-,19+,20-/m0/s1

Standard InChI Key:  JUVZOSSLRSWOQW-UMKCFBIFSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
    8.2919  -10.6086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8835   -9.8961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4706  -10.6059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1752   -8.6627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1752   -9.4877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8872   -8.2460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5992   -8.6627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6003   -9.4877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3114   -9.8970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0259   -9.4859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3092   -8.2471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7406   -8.2497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7431   -7.4216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0255   -7.0071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3055   -7.4206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5918   -7.8377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8612  -10.2792    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.0211   -8.6586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4531   -8.6657    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4545   -7.8335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3253   -6.8335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1232   -7.0429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1077   -6.0377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3044   -9.0711    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  6  1  0
  5  2  1  0
  2  8  1  0
  7  6  1  0
  7  8  1  0
  7 11  1  0
  8  9  1  0
  9 10  1  0
 10 18  1  0
 11 15  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
  7 16  1  1
  8 17  1  6
 11 18  1  0
 12 18  1  0
 12 19  1  1
 13 20  1  1
 13 21  1  0
 21 22  1  0
 21 23  1  0
 11 24  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4877941

    ---

Associated Targets(Human)

CYP19A1 Tclin Cytochrome P450 19A1 (6099 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 308.51Molecular Weight (Monoisotopic): 308.2715AlogP: 4.39#Rotatable Bonds: 1
Polar Surface Area: 40.46Molecular Species: NEUTRALHBA: 2HBD: 2
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.41CX Basic pKa: CX LogP: 4.34CX LogD: 4.34
Aromatic Rings: Heavy Atoms: 22QED Weighted: 0.75Np Likeness Score: 2.78

References

1. Chawengrum P, Boonsombat J, Mahidol C, Eurtivong C, Kittakoop P, Thongnest S, Ruchirawat S..  (2021)  Diterpenoids with Aromatase Inhibitory Activity from the Rhizomes of Kaempferia elegans.,  84  (6.0): [PMID:34110821] [10.1021/acs.jnatprod.0c01292]

Source