The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-(3-(5,7-Dihydroxy-4-oxo-4H-chromen-2-yl)phenyl)-5,7-dihydroxy-2-(4-(trifluoromethyl)phenyl)-4H-chromen-4-one ID: ALA4877975
PubChem CID: 164628740
Max Phase: Preclinical
Molecular Formula: C31H17F3O8
Molecular Weight: 574.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=c1cc(-c2cccc(-c3c(O)cc(O)c4c(=O)cc(-c5ccc(C(F)(F)F)cc5)oc34)c2)oc2cc(O)cc(O)c12
Standard InChI: InChI=1S/C31H17F3O8/c32-31(33,34)17-6-4-14(5-7-17)24-13-23(40)29-21(38)11-20(37)27(30(29)42-24)16-3-1-2-15(8-16)25-12-22(39)28-19(36)9-18(35)10-26(28)41-25/h1-13,35-38H
Standard InChI Key: QKELJHYVBHTGEK-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
10.7762 -15.3327 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.1889 -16.0425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5973 -15.3302 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.9673 -13.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9661 -14.8232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6783 -15.2363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6765 -13.5907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3851 -13.9959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3926 -14.8207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1011 -15.2300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8148 -14.8149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8115 -13.9901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0943 -13.5804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6741 -12.7693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2540 -15.2353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0899 -12.7591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5278 -15.2257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5258 -16.0477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2379 -16.4543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9496 -16.0438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9448 -15.2182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2321 -14.8112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2398 -17.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5296 -17.6870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5311 -18.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2444 -18.9154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9527 -17.6816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9541 -18.4980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6585 -18.9007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3659 -18.4955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3645 -17.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6556 -17.2679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6588 -19.7220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2494 -19.7367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8175 -17.2748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0692 -17.2712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7771 -17.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4844 -17.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4850 -16.4558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7724 -16.0473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0680 -16.4574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9004 -16.4542 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
7 14 1 0
5 15 1 0
13 16 2 0
11 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
19 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 28 1 0
27 23 1 0
27 28 2 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
29 33 2 0
26 34 1 0
24 35 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
31 36 1 0
39 2 1 0
2 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 574.46Molecular Weight (Monoisotopic): 574.0876AlogP: 6.74#Rotatable Bonds: 3Polar Surface Area: 141.34Molecular Species: ACIDHBA: 8HBD: 4#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.20CX Basic pKa: ┄CX LogP: 6.57CX LogD: 4.62Aromatic Rings: 6Heavy Atoms: 42QED Weighted: 0.18Np Likeness Score: 0.63
References 1. Long H, Hu X, Wang B, Wang Q, Wang R, Liu S, Xiong F, Jiang Z, Zhang XQ, Ye WC, Wang H.. (2021) Discovery of Novel Apigenin-Piperazine Hybrids as Potent and Selective Poly (ADP-Ribose) Polymerase-1 (PARP-1) Inhibitors for the Treatment of Cancer., 64 (16.0): [PMID:34404206 ] [10.1021/acs.jmedchem.1c00735 ]