8-(3-(5,7-Dihydroxy-4-oxo-4H-chromen-2-yl)phenyl)-5,7-dihydroxy-2-(4-(trifluoromethyl)phenyl)-4H-chromen-4-one

ID: ALA4877975

PubChem CID: 164628740

Max Phase: Preclinical

Molecular Formula: C31H17F3O8

Molecular Weight: 574.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=c1cc(-c2cccc(-c3c(O)cc(O)c4c(=O)cc(-c5ccc(C(F)(F)F)cc5)oc34)c2)oc2cc(O)cc(O)c12

Standard InChI:  InChI=1S/C31H17F3O8/c32-31(33,34)17-6-4-14(5-7-17)24-13-23(40)29-21(38)11-20(37)27(30(29)42-24)16-3-1-2-15(8-16)25-12-22(39)28-19(36)9-18(35)10-26(28)41-25/h1-13,35-38H

Standard InChI Key:  QKELJHYVBHTGEK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 42 47  0  0  0  0  0  0  0  0999 V2000
   10.7762  -15.3327    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.1889  -16.0425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5973  -15.3302    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.9673  -13.9995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9661  -14.8232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6783  -15.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6765  -13.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3851  -13.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3926  -14.8207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1011  -15.2300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8148  -14.8149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8115  -13.9901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0943  -13.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6741  -12.7693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2540  -15.2353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0899  -12.7591    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5278  -15.2257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5258  -16.0477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2379  -16.4543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9496  -16.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9448  -15.2182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2321  -14.8112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2398  -17.2756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5296  -17.6870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5311  -18.5076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2444  -18.9154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9527  -17.6816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9541  -18.4980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6585  -18.9007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3659  -18.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3645  -17.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6556  -17.2679    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6588  -19.7220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2494  -19.7367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8175  -17.2748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0692  -17.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7771  -17.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4844  -17.2739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4850  -16.4558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7724  -16.0473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0680  -16.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9004  -16.4542    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
  7 14  1  0
  5 15  1  0
 13 16  2  0
 11 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 19 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 28  1  0
 27 23  1  0
 27 28  2  0
 27 32  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 29 33  2  0
 26 34  1  0
 24 35  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 31 36  1  0
 39  2  1  0
  2 42  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877975

    ---

Associated Targets(Human)

PARP1 Tclin Poly [ADP-ribose] polymerase-1 (6206 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PARP2 Tclin Poly [ADP-ribose] polymerase 2 (1185 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 574.46Molecular Weight (Monoisotopic): 574.0876AlogP: 6.74#Rotatable Bonds: 3
Polar Surface Area: 141.34Molecular Species: ACIDHBA: 8HBD: 4
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 6.20CX Basic pKa: CX LogP: 6.57CX LogD: 4.62
Aromatic Rings: 6Heavy Atoms: 42QED Weighted: 0.18Np Likeness Score: 0.63

References

1. Long H, Hu X, Wang B, Wang Q, Wang R, Liu S, Xiong F, Jiang Z, Zhang XQ, Ye WC, Wang H..  (2021)  Discovery of Novel Apigenin-Piperazine Hybrids as Potent and Selective Poly (ADP-Ribose) Polymerase-1 (PARP-1) Inhibitors for the Treatment of Cancer.,  64  (16.0): [PMID:34404206] [10.1021/acs.jmedchem.1c00735]

Source