The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-((4-isopentylpiperazin-1-yl)methyl)-4H-chromen-4-one ID: ALA4877994
PubChem CID: 164629187
Max Phase: Preclinical
Molecular Formula: C25H30N2O5
Molecular Weight: 438.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)CCN1CCN(Cc2c(O)cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc23)CC1
Standard InChI: InChI=1S/C25H30N2O5/c1-16(2)7-8-26-9-11-27(12-10-26)15-19-20(29)13-21(30)24-22(31)14-23(32-25(19)24)17-3-5-18(28)6-4-17/h3-6,13-14,16,28-30H,7-12,15H2,1-2H3
Standard InChI Key: GAVTZFDXFKIUNT-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
19.5434 -21.6364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5423 -22.4637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2570 -22.8766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2552 -21.2236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9705 -21.6328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9694 -22.4658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6863 -22.8810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4089 -22.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4101 -21.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6886 -21.2149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8289 -21.2240 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2567 -23.7015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6839 -23.7060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2528 -20.3986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5371 -19.9883 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5372 -19.1599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8257 -18.7496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1101 -19.1607 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1105 -19.9866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8266 -20.4014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3960 -18.7476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6811 -19.1596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1238 -21.2266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8375 -21.6427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5525 -21.2326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5549 -20.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8365 -19.9926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1244 -20.4051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2698 -19.9950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9671 -18.7465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2523 -19.1584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9677 -17.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
1 11 1 0
3 12 1 0
7 13 2 0
4 14 1 0
14 15 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
18 21 1 0
21 22 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
9 23 1 0
26 29 1 0
22 30 1 0
30 31 1 0
30 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.52Molecular Weight (Monoisotopic): 438.2155AlogP: 3.74#Rotatable Bonds: 6Polar Surface Area: 97.38Molecular Species: ACIDHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.71CX Basic pKa: 7.54CX LogP: 2.75CX LogD: 2.63Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: 0.40
References 1. Long H, Hu X, Wang B, Wang Q, Wang R, Liu S, Xiong F, Jiang Z, Zhang XQ, Ye WC, Wang H.. (2021) Discovery of Novel Apigenin-Piperazine Hybrids as Potent and Selective Poly (ADP-Ribose) Polymerase-1 (PARP-1) Inhibitors for the Treatment of Cancer., 64 (16.0): [PMID:34404206 ] [10.1021/acs.jmedchem.1c00735 ]