(1R,5S,6r)-N3-ethyl-N3-methyl-N6-((S)-1-(thiazolo[4,5-c]pyridin-4-yl)pyrrolidin-3-yl)-3-azabicyclo[3.1.0]hexane-3,6-dicarboxamide

ID: ALA4877999

PubChem CID: 164629190

Max Phase: Preclinical

Molecular Formula: C20H26N6O2S

Molecular Weight: 414.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(C)C(=O)N1C[C@@H]2[C@H](C1)[C@H]2C(=O)N[C@H]1CCN(c2nccc3scnc23)C1

Standard InChI:  InChI=1S/C20H26N6O2S/c1-3-24(2)20(28)26-9-13-14(10-26)16(13)19(27)23-12-5-7-25(8-12)18-17-15(4-6-21-18)29-11-22-17/h4,6,11-14,16H,3,5,7-10H2,1-2H3,(H,23,27)/t12-,13-,14+,16+/m0/s1

Standard InChI Key:  DJOSRQKBBTXJBM-TTZDDIAXSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   29.4312  -27.2315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2484  -27.2315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5028  -26.4548    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.8398  -25.9726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1811  -26.4548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2712  -26.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4038  -26.2026    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.7967  -26.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0194  -26.4975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9670  -27.5489    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.2209  -26.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4737  -25.8931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8114  -25.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1491  -25.8933    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4023  -26.6717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0499  -25.3082    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   26.4308  -27.4585    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   24.3719  -25.6409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2018  -24.8416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.7647  -26.1878    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.9654  -26.0188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8503  -27.0011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4192  -26.6266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8655  -26.7505    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.6312  -26.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8044  -25.7158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4336  -25.4183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2045  -25.1723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2088  -24.3631    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.4405  -24.1089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9615  -24.7611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  3  6  1  0
  5  7  1  6
  7  8  1  0
  9  8  1  1
  8 10  2  0
 12  9  1  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 12 16  1  1
 11 17  1  1
 14 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 22 20  1  0
 21 23  1  0
  6 24  2  0
  6 27  1  0
 24 25  1  0
 25 26  2  0
 26 28  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877999

    ---

Associated Targets(Human)

ACKR3 Tchem C-X-C chemokine receptor type 7 (1102 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.54Molecular Weight (Monoisotopic): 414.1838AlogP: 1.64#Rotatable Bonds: 4
Polar Surface Area: 81.67Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.79CX LogP: 0.13CX LogD: 0.13
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.82Np Likeness Score: -1.38

References

1. Aspnes GE, Menhaji-Klotz E, Boehm M, Londregan AT, Lee ECY, Limberakis C, Coffey SB, Brown JA, Jones RM, Hesp KD..  (2021)  Discovery and evaluation of non-basic small molecule modulators of the atypical chemokine receptor CXCR7.,  50  [PMID:34400299] [10.1016/j.bmcl.2021.128320]

Source