The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Fluoro-N-(4-(N-phenylsulfamoyl)phenyl)-4-(trifluoromethyl)benzamide ID: ALA4878026
PubChem CID: 164625814
Max Phase: Preclinical
Molecular Formula: C20H14F4N2O3S
Molecular Weight: 438.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1)c1ccc(C(F)(F)F)cc1F
Standard InChI: InChI=1S/C20H14F4N2O3S/c21-18-12-13(20(22,23)24)6-11-17(18)19(27)25-14-7-9-16(10-8-14)30(28,29)26-15-4-2-1-3-5-15/h1-12,26H,(H,25,27)
Standard InChI Key: WQEULRZTDZOICN-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
5.9638 -9.5876 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.5594 -8.8818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1504 -9.5850 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.5067 -5.3117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9194 -6.0216 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.3279 -5.3093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3901 -7.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6810 -7.6558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9719 -7.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2670 -7.6558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2670 -8.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9719 -8.8816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6810 -8.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3901 -6.4300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0951 -7.6558 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8042 -7.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5133 -7.6558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2182 -7.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2182 -6.4300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5133 -6.0214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8042 -6.4300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6270 -6.4383 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6190 -7.2531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3240 -7.6686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3180 -8.4870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6069 -8.8898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9019 -8.4742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9079 -7.6558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9709 -6.4300 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.8511 -8.4783 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 2 0
6 5 2 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
8 13 2 0
7 14 2 0
7 15 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
16 21 2 0
5 22 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
23 28 2 0
22 23 1 0
19 5 1 0
15 16 1 0
9 29 1 0
11 2 1 0
2 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.40Molecular Weight (Monoisotopic): 438.0661AlogP: 4.90#Rotatable Bonds: 5Polar Surface Area: 75.27Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.94CX Basic pKa: ┄CX LogP: 4.57CX LogD: 4.48Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.56Np Likeness Score: -1.93
References 1. Pillaiyar T, Rosato F, Wozniak M, Blavier J, Charles M, Laschet C, Kronenberger T, Müller CE, Hanson J.. (2021) Structure-activity relationships of agonists for the orphan G protein-coupled receptor GPR27., 225 [PMID:34454125 ] [10.1016/j.ejmech.2021.113777 ]