2-Fluoro-N-(4-(N-phenylsulfamoyl)phenyl)-4-(trifluoromethyl)benzamide

ID: ALA4878026

PubChem CID: 164625814

Max Phase: Preclinical

Molecular Formula: C20H14F4N2O3S

Molecular Weight: 438.40

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1)c1ccc(C(F)(F)F)cc1F

Standard InChI:  InChI=1S/C20H14F4N2O3S/c21-18-12-13(20(22,23)24)6-11-17(18)19(27)25-14-7-9-16(10-8-14)30(28,29)26-15-4-2-1-3-5-15/h1-12,26H,(H,25,27)

Standard InChI Key:  WQEULRZTDZOICN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    5.9638   -9.5876    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.5594   -8.8818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1504   -9.5850    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.5067   -5.3117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9194   -6.0216    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.3279   -5.3093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3901   -7.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6810   -7.6558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9719   -7.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2670   -7.6558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2670   -8.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9719   -8.8816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6810   -8.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3901   -6.4300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0951   -7.6558    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8042   -7.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5133   -7.6558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2182   -7.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2182   -6.4300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5133   -6.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8042   -6.4300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6270   -6.4383    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.6190   -7.2531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3240   -7.6686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3180   -8.4870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6069   -8.8898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9019   -8.4742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9079   -7.6558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9709   -6.4300    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.8511   -8.4783    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  2  0
  6  5  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
  8 13  2  0
  7 14  2  0
  7 15  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 16 21  2  0
  5 22  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 23 28  2  0
 22 23  1  0
 19  5  1  0
 15 16  1  0
  9 29  1  0
 11  2  1  0
  2 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4878026

    ---

Associated Targets(Human)

GPR27 Tbio Probable G-protein coupled receptor 27 (65 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HEK293 (82097 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 438.40Molecular Weight (Monoisotopic): 438.0661AlogP: 4.90#Rotatable Bonds: 5
Polar Surface Area: 75.27Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.94CX Basic pKa: CX LogP: 4.57CX LogD: 4.48
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.56Np Likeness Score: -1.93

References

1. Pillaiyar T, Rosato F, Wozniak M, Blavier J, Charles M, Laschet C, Kronenberger T, Müller CE, Hanson J..  (2021)  Structure-activity relationships of agonists for the orphan G protein-coupled receptor GPR27.,  225  [PMID:34454125] [10.1016/j.ejmech.2021.113777]

Source