4-(3-(2-(4-chlorophenylamino)-4-(dimethylamino)thiazol-5-yl)-2-(ethoxycarbonyl)-3-oxoprop-1-enyl)phenylboronic acid

ID: ALA4878027

PubChem CID: 164625815

Max Phase: Preclinical

Molecular Formula: C23H23BClN3O5S

Molecular Weight: 499.79

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  CCOC(=O)/C(=C\c1ccc(B(O)O)cc1)C(=O)c1sc(Nc2ccc(Cl)cc2)nc1N(C)C

Standard InChI:  InChI=1S/C23H23BClN3O5S/c1-4-33-22(30)18(13-14-5-7-15(8-6-14)24(31)32)19(29)20-21(28(2)3)27-23(34-20)26-17-11-9-16(25)10-12-17/h5-13,31-32H,4H2,1-3H3,(H,26,27)/b18-13-

Standard InChI Key:  FGLYUBCIIUEDQZ-AQTBWJFISA-N

Molfile:  

 
     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    4.8068  -19.5329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8057  -20.3602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5205  -20.7731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2369  -20.3598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2340  -19.5293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5186  -19.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9469  -19.1142    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6629  -19.5239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7560  -20.3430    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5636  -20.5115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9734  -19.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4189  -19.1845    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.7935  -19.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2810  -20.3716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1262  -18.9510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9484  -21.1265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1011  -20.2822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5886  -20.9477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4337  -19.5272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4087  -20.8583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8962  -21.5238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4358  -21.7921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0981  -22.5451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5848  -23.2102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4059  -23.1211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7378  -22.3612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2491  -21.6993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8943  -23.7861    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
   11.5625  -24.5414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7142  -23.6956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0908  -20.7722    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    8.6943  -21.3261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0549  -21.8473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4654  -21.6191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
 11 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  2  0
 14 17  1  0
 17 18  1  0
 17 19  2  0
 18 20  1  0
 20 21  1  0
 16 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 25 28  1  0
 28 29  1  0
 28 30  1  0
  2 31  1  0
 10 32  1  0
 32 33  1  0
 32 34  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4878027

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 499.79

Molecular Weight (Monoisotopic): 499.1140

AlogP: ┄

#Rotatable Bonds: ┄

Polar Surface Area: ┄

Molecular Species: ┄

HBA: ┄

HBD: ┄

#RO5 Violations: ┄

HBA (Lipinski): ┄

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: ┄

CX LogD: ┄

Aromatic Rings: ┄

Heavy Atoms: ┄

QED Weighted: ┄

Np Likeness Score: ┄

References

1. Patle R, Shinde S, Patel S, Maheshwari R, Jariyal H, Srivastava A, Chauhan N, Globisch C, Jain A, Tekade RK, Shard A..  (2021)  Discovery of boronic acid-based potent activators of tumor pyruvate kinase M2 and development of gastroretentive nanoformulation for oral dosing.,  42  [PMID:33901643] [10.1016/j.bmcl.2021.128062]

2. Rihan M, Vineela Nalla L, Dharavath A, Patel S, Shard A, Khairnar A..  (2022)  Boronic acid derivative activates pyruvate kinase M2 indispensable for redox metabolism in oral cancer cells.,  59  [PMID:35007726] [10.1016/j.bmcl.2022.128539]

Source

Source(1):

• Scientific Literature