4-(2-(2,4-dimethoxybenzylamino)-2-oxoethoxy)-N-(2,3-dimethylphenyl)benzamide

ID: ALA4878030

PubChem CID: 164625818

Max Phase: Preclinical

Molecular Formula: C26H28N2O5

Molecular Weight: 448.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CNC(=O)COc2ccc(C(=O)Nc3cccc(C)c3C)cc2)c(OC)c1

Standard InChI:  InChI=1S/C26H28N2O5/c1-17-6-5-7-23(18(17)2)28-26(30)19-8-11-21(12-9-19)33-16-25(29)27-15-20-10-13-22(31-3)14-24(20)32-4/h5-14H,15-16H2,1-4H3,(H,27,29)(H,28,30)

Standard InChI Key:  PJYDTOLZKXRWMX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   15.9226  -12.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6322  -11.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6322  -10.8551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9208  -10.4498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2158  -10.8572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2158  -11.6782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5083  -10.4482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5083   -9.6310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3406  -12.0852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0477  -11.6755    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7560  -12.0830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4631  -11.6733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1714  -12.0808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8785  -11.6711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5840  -12.0788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2897  -11.6698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2897  -10.8517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5764  -10.4444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8785  -10.8558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9963  -10.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9963   -9.6239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.7052  -10.8476    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.4117  -10.4370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1177  -10.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8237  -10.4340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8237   -9.6160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1079   -9.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4117   -9.6219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5324  -10.8409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1177  -11.6612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7560  -12.9002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9226  -12.9044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2146  -13.3128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  6  5  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  2  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 25 29  1  0
 24 30  1  0
 11 31  2  0
  1 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4878030

    ---

Associated Targets(Human)

MEIS1 Tbio Homeobox protein Meis1 (130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.52Molecular Weight (Monoisotopic): 448.1998AlogP: 4.27#Rotatable Bonds: 9
Polar Surface Area: 85.89Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.10CX Basic pKa: CX LogP: 4.24CX LogD: 4.24
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.51Np Likeness Score: -1.40

References

1. Turgutalp B, Uslu M, Helvacioglu S, Charehsaz M, Gurdal EE, Sippl W, Kocabas F, Yarim M..  (2021)  Lead Optimization and Structure-Activity Relationship Studies on Myeloid Ecotropic Viral Integration Site 1 Inhibitor.,  64  (19.0): [PMID:34542289] [10.1021/acs.jmedchem.1c00972]

Source