3-((1-(3-bromobenzoyl)-4-hydroxypiperidin-4-yl)methyl)-7-chloroquinazolin-4(3H)-one

ID: ALA4878033

PubChem CID: 164625819

Max Phase: Preclinical

Molecular Formula: C21H19BrClN3O3

Molecular Weight: 476.76

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1cccc(Br)c1)N1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1

Standard InChI:  InChI=1S/C21H19BrClN3O3/c22-15-3-1-2-14(10-15)19(27)25-8-6-21(29,7-9-25)12-26-13-24-18-11-16(23)4-5-17(18)20(26)28/h1-5,10-11,13,29H,6-9,12H2

Standard InChI Key:  NJPZHJFERTVBDS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    0.5412  -20.6519    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.2474  -20.2407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9551  -20.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9439  -19.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2411  -19.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6581  -19.4214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6577  -20.2355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3586  -20.6406    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0645  -20.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0649  -19.4221    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3595  -19.0124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3588  -18.1952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7732  -19.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4803  -19.4243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4733  -20.2407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1763  -20.6503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8870  -20.2463    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8903  -19.4281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1827  -19.0140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6873  -18.6303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5926  -20.6586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5882  -21.4758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3024  -20.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0049  -20.6705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7143  -20.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7191  -19.4483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0086  -19.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3021  -19.4426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0100  -18.2189    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  7  1  0
  6  4  1  0
  4  5  2  0
  5  2  1  0
  6  7  2  0
  6 11  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 19  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 14 20  1  0
 17 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 27 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4878033

    ---

Associated Targets(Human)

USP7 Tchem Ubiquitin carboxyl-terminal hydrolase 7 (837 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 476.76Molecular Weight (Monoisotopic): 475.0298AlogP: 3.48#Rotatable Bonds: 3
Polar Surface Area: 75.43Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.56CX LogP: 2.66CX LogD: 2.66
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.63Np Likeness Score: -1.27

References

1. Li P, Liu Y, Yang H, Liu HM..  (2021)  Design, synthesis, biological evaluation and structure-activity relationship study of quinazolin-4(3H)-one derivatives as novel USP7 inhibitors.,  216  [PMID:33684824] [10.1016/j.ejmech.2021.113291]

Source