The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(3-acetyl-2-(4-(4-methoxyphenoxy)phenyl)-1H-imidazo[1,2-b]pyrazol-7-yl)phenyl)propiolamide ID: ALA4878064
PubChem CID: 164626389
Max Phase: Preclinical
Molecular Formula: C27H19N5O3
Molecular Weight: 461.48
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CC(=O)Nc1ccc(-c2cnn3c(C(N)=O)c(-c4ccc(Oc5ccccc5)cc4)[nH]c23)cc1
Standard InChI: InChI=1S/C27H19N5O3/c1-2-23(33)30-19-12-8-17(9-13-19)22-16-29-32-25(26(28)34)24(31-27(22)32)18-10-14-21(15-11-18)35-20-6-4-3-5-7-20/h1,3-16,31H,(H2,28,34)(H,30,33)
Standard InChI Key: WXFGDGZQJKXMJQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
13.5908 -3.9265 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8469 -3.1403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1794 -2.6550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7640 -3.9265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5091 -3.1431 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6854 -3.1447 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4293 -3.9290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0975 -4.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0979 -5.2361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1779 -1.8282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4606 -1.4140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8897 -1.4113 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6301 -2.8859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2448 -3.4390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0311 -3.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2039 -2.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5841 -1.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8044 -2.0803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9904 -2.1228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6059 -2.6775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4310 -3.4849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0414 -4.0352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8290 -3.7811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0026 -2.9675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3865 -2.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3848 -5.6464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3848 -6.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0977 -6.8799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8122 -6.4639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8087 -5.6436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0991 -7.7025 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8124 -8.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8138 -8.9352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5242 -7.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8176 -9.7535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 1 1 0
1 2 1 0
2 3 2 0
3 5 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 4 2 0
8 9 1 0
3 10 1 0
10 11 2 0
10 12 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
2 13 1 0
16 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
9 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 9 1 0
28 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
33 35 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.48Molecular Weight (Monoisotopic): 461.1488AlogP: 4.46#Rotatable Bonds: 6Polar Surface Area: 114.51Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.75CX Basic pKa: ┄CX LogP: 3.99CX LogD: 3.99Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.32Np Likeness Score: -0.83
References 1. Zhang D, Xu G, Zhao J, Wang Y, Wu X, He X, Li W, Zhang S, Yang S, Ma C, Jiang Y, Ding Q.. (2021) Structure-activity relationship investigation for imidazopyrazole-3-carboxamide derivatives as novel selective inhibitors of Bruton's tyrosine kinase., 225 [PMID:34391034 ] [10.1016/j.ejmech.2021.113724 ]