N-(4-(3-acetyl-2-(4-(4-methoxyphenoxy)phenyl)-1H-imidazo[1,2-b]pyrazol-7-yl)phenyl)propiolamide

ID: ALA4878064

PubChem CID: 164626389

Max Phase: Preclinical

Molecular Formula: C27H19N5O3

Molecular Weight: 461.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C#CC(=O)Nc1ccc(-c2cnn3c(C(N)=O)c(-c4ccc(Oc5ccccc5)cc4)[nH]c23)cc1

Standard InChI:  InChI=1S/C27H19N5O3/c1-2-23(33)30-19-12-8-17(9-13-19)22-16-29-32-25(26(28)34)24(31-27(22)32)18-10-14-21(15-11-18)35-20-6-4-3-5-7-20/h1,3-16,31H,(H2,28,34)(H,30,33)

Standard InChI Key:  WXFGDGZQJKXMJQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   13.5908   -3.9265    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8469   -3.1403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1794   -2.6550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7640   -3.9265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5091   -3.1431    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6854   -3.1447    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4293   -3.9290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0975   -4.4137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0979   -5.2361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1779   -1.8282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4606   -1.4140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8897   -1.4113    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.6301   -2.8859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2448   -3.4390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0311   -3.1863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2039   -2.3770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5841   -1.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8044   -2.0803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9904   -2.1228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6059   -2.6775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4310   -3.4849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0414   -4.0352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8290   -3.7811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0026   -2.9675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3865   -2.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3848   -5.6464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3848   -6.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0977   -6.8799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8122   -6.4639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8087   -5.6436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0991   -7.7025    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8124   -8.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8138   -8.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5242   -7.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8176   -9.7535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  1  1  0
  1  2  1  0
  2  3  2  0
  3  5  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  4  2  0
  8  9  1  0
  3 10  1  0
 10 11  2  0
 10 12  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  2 13  1  0
 16 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  9 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30  9  1  0
 28 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  3  0
M  END

Alternative Forms

  1. Parent:

    ALA4878064

    ---

Associated Targets(Human)

BTK Tclin Tyrosine-protein kinase BTK (8973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 461.48Molecular Weight (Monoisotopic): 461.1488AlogP: 4.46#Rotatable Bonds: 6
Polar Surface Area: 114.51Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 11.75CX Basic pKa: CX LogP: 3.99CX LogD: 3.99
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.32Np Likeness Score: -0.83

References

1. Zhang D, Xu G, Zhao J, Wang Y, Wu X, He X, Li W, Zhang S, Yang S, Ma C, Jiang Y, Ding Q..  (2021)  Structure-activity relationship investigation for imidazopyrazole-3-carboxamide derivatives as novel selective inhibitors of Bruton's tyrosine kinase.,  225  [PMID:34391034] [10.1016/j.ejmech.2021.113724]

Source