The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(1-(but-2-ynoyl)piperidin-4-yl)-2-(4-phenoxyphenyl)-1H-imidazo[1,2-b]pyrazole-3-carboxamide ID: ALA4878090
PubChem CID: 164176059
Max Phase: Preclinical
Molecular Formula: C27H25N5O3
Molecular Weight: 467.53
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC#CC(=O)N1CCC(c2cnn3c(C(N)=O)c(-c4ccc(Oc5ccccc5)cc4)[nH]c23)CC1
Standard InChI: InChI=1S/C27H25N5O3/c1-2-6-23(33)31-15-13-18(14-16-31)22-17-29-32-25(26(28)34)24(30-27(22)32)19-9-11-21(12-10-19)35-20-7-4-3-5-8-20/h3-5,7-12,17-18,30H,13-16H2,1H3,(H2,28,34)
Standard InChI Key: ZZQMSKHNPZIQCU-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
3.3302 -28.5150 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5862 -27.7294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9191 -27.2443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5039 -28.5150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2493 -27.7323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4260 -27.7338 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1700 -28.5175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8379 -29.0019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8382 -29.8238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1210 -30.2350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1206 -31.0578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8358 -31.4755 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5529 -31.0602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5550 -30.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8341 -32.3018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9176 -26.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2007 -26.0041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6289 -26.0014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3689 -27.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9832 -28.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7690 -27.7753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9417 -26.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3223 -26.4145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5430 -26.6699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7278 -26.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3429 -27.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1681 -28.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7782 -28.6237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5653 -28.3697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7387 -27.5567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1231 -27.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5455 -32.7142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1214 -32.7116 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2534 -33.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9653 -33.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 1 1 0
1 2 1 0
2 3 2 0
3 5 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 4 2 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
8 9 1 0
12 15 1 0
3 16 1 0
16 17 2 0
16 18 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
2 19 1 0
22 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
15 32 1 0
15 33 2 0
32 34 3 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.53Molecular Weight (Monoisotopic): 467.1957AlogP: 3.95#Rotatable Bonds: 5Polar Surface Area: 105.72Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.95CX Basic pKa: 0.16CX LogP: 3.66CX LogD: 3.66Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.43Np Likeness Score: -0.73
References 1. Zhang D, Xu G, Zhao J, Wang Y, Wu X, He X, Li W, Zhang S, Yang S, Ma C, Jiang Y, Ding Q.. (2021) Structure-activity relationship investigation for imidazopyrazole-3-carboxamide derivatives as novel selective inhibitors of Bruton's tyrosine kinase., 225 [PMID:34391034 ] [10.1016/j.ejmech.2021.113724 ]