The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1,3-Dimethoxypropan-2-yl)-N-(2,2-diphenylethyl)-1,5-dimethyl-6-oxo-1,6-dihydropyridine-3-carboxamide ID: ALA4878095
PubChem CID: 164626647
Max Phase: Preclinical
Molecular Formula: C27H32N2O4
Molecular Weight: 448.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COCC(COC)N(CC(c1ccccc1)c1ccccc1)C(=O)c1cc(C)c(=O)n(C)c1
Standard InChI: InChI=1S/C27H32N2O4/c1-20-15-23(16-28(2)26(20)30)27(31)29(24(18-32-3)19-33-4)17-25(21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-16,24-25H,17-19H2,1-4H3
Standard InChI Key: IWLBVRGLNVHOOQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
39.4631 -19.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4620 -20.2133 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.1700 -20.6223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8797 -20.2129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8769 -19.3902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1683 -18.9849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7553 -18.9854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.1658 -18.1678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5881 -20.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5893 -21.4375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.2951 -20.2107 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.0029 -20.6185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2467 -21.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0446 -21.5678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6948 -21.9938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8973 -21.8128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3456 -22.4146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5914 -23.1949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3940 -23.3699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9422 -22.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2874 -22.3461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0844 -22.5230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6373 -21.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3875 -21.1374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5910 -20.9643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7540 -20.6214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2941 -19.3935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0014 -18.9840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0004 -18.1668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.5859 -18.9857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5850 -18.1685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.8768 -17.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7076 -17.7574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 2 0
6 8 1 0
4 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
14 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 14 1 0
2 26 1 0
11 27 1 0
27 28 1 0
28 29 1 0
27 30 1 0
30 31 1 0
31 32 1 0
29 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.56Molecular Weight (Monoisotopic): 448.2362AlogP: 3.63#Rotatable Bonds: 10Polar Surface Area: 60.77Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 0.13CX LogP: 3.19CX LogD: 3.19Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.48Np Likeness Score: -0.61
References 1. Rianjongdee F, Atkinson SJ, Chung CW, Grandi P, Gray JRJ, Kaushansky LJ, Medeiros P, Messenger C, Phillipou A, Preston A, Prinjha RK, Rioja I, Satz AL, Taylor S, Wall ID, Watson RJ, Yao G, Demont EH.. (2021) Discovery of a Highly Selective BET BD2 Inhibitor from a DNA-Encoded Library Technology Screening Hit., 64 (15.0): [PMID:34251219 ] [10.1021/acs.jmedchem.1c00412 ]