NA

ID: ALA4878105

PubChem CID: 164626876

Max Phase: Preclinical

Molecular Formula: C28H29ClN4O4

Molecular Weight: 484.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cl.O=C(N[C@@H]1C=C[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5)c1c[nH]c2cnccc12

Standard InChI:  InChI=1S/C28H28N4O4.ClH/c33-21-4-3-16-11-22-28(35)7-5-19(31-26(34)18-12-30-20-13-29-9-6-17(18)20)25-27(28,23(16)24(21)36-25)8-10-32(22)14-15-1-2-15;/h3-7,9,12-13,15,19,22,25,30,33,35H,1-2,8,10-11,14H2,(H,31,34);1H/t19-,22-,25+,27+,28-;/m1./s1

Standard InChI Key:  QICNIOAJLOMREN-IANQOIEHSA-N

Molfile:  

     RDKit          2D

 39 45  0  0  0  0  0  0  0  0999 V2000
   18.9750  -23.4241    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   17.6452  -20.8102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8256  -20.8102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0613  -20.0999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4262  -21.5122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0487  -21.5122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1996  -21.9997    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6242  -19.3895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4262  -20.0999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8809  -20.0999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8256  -19.3895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6452  -18.5657    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2249  -20.0957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2929  -20.8144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8726  -21.5247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6024  -21.5122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2249  -19.0868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6024  -20.0999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1863  -20.8102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1779  -22.2351    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.2802  -22.2435    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0571  -17.8386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0445  -22.4326    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.4732  -19.3769    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3345  -18.9776    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.1125  -22.2498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5231  -22.9737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5340  -21.5323    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8893  -17.8317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6103  -18.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6035  -17.4060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1832  -23.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7974  -24.2915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.3545  -23.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5173  -23.8775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3005  -24.1409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9214  -23.5933    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.7541  -22.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9710  -22.5194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
  4  2  1  0
  5  3  2  0
  6  2  1  0
  7  6  1  0
  8  4  1  0
  9  3  1  0
 10  4  1  0
 11  8  1  0
 12 17  1  0
  2 13  1  1
 14 15  1  0
 15  6  1  0
 16  5  1  0
 17 13  1  0
 18  9  2  0
 19 18  1  0
 20 16  1  0
 15 21  1  1
 22 12  1  0
  6 23  1  1
  4 24  1  1
  8 25  1  6
  7  5  1  0
 12  8  1  0
 14 10  2  0
 11  9  1  0
 16 19  2  0
 21 26  1  0
 26 27  1  0
 26 28  2  0
 22 29  1  0
 30 29  1  0
 31 30  1  0
 29 31  1  0
 27 32  2  0
 32 33  1  0
 33 35  1  0
 34 27  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
M  END

Associated Targets(Human)

OPRM1 Tclin Mu opioid receptor (19785 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.56Molecular Weight (Monoisotopic): 484.2111AlogP: 2.41#Rotatable Bonds: 4
Polar Surface Area: 110.71Molecular Species: BASEHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 10.22CX Basic pKa: 9.41CX LogP: 1.23CX LogD: -0.49
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.42Np Likeness Score: 0.83

References

1. Ma H, Wang H, Gillespie JC, Mendez RE, Selley DE, Zhang Y..  (2021)  Exploring naltrexamine derivatives featuring azaindole moiety via nitrogen-walk approach to investigate their in vitro pharmacological profiles at the mu opioid receptor.,  41  [PMID:33766769] [10.1016/j.bmcl.2021.127953]

Source