The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Microhelenalin B ID: ALA4878114
Cas Number: 63569-08-4
PubChem CID: 182376
Max Phase: Preclinical
Molecular Formula: C20H28O5
Molecular Weight: 348.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCC(C)C(=O)O[C@H]1[C@@H]2[C@H](C)C(=O)O[C@@H]2C[C@@H](C)[C@@H]2C=CC(=O)[C@]21C
Standard InChI: InChI=1S/C20H28O5/c1-6-10(2)18(22)25-17-16-12(4)19(23)24-14(16)9-11(3)13-7-8-15(21)20(13,17)5/h7-8,10-14,16-17H,6,9H2,1-5H3/t10?,11-,12+,13+,14-,16-,17+,20+/m1/s1
Standard InChI Key: VSRLMYQKLUPERI-JCQBEPMYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
4.6443 -24.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0450 -22.7925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2252 -22.7988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9064 -24.2363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7138 -23.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8949 -23.3744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5814 -24.1336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2066 -24.6662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5581 -23.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3786 -24.2266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0806 -24.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6940 -24.1046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3709 -23.3549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3737 -25.0399 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.4912 -24.2841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9597 -22.7163 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.8685 -22.0636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9002 -25.0523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6494 -25.4047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2977 -22.7245 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.1434 -25.4809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3596 -25.8088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3647 -26.6260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0648 -25.3958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6596 -27.0390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0750 -27.0302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4839 -25.3453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0801 -27.8474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10 1 1 0
1 4 1 0
9 2 1 0
5 3 1 0
2 3 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 4 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 9 1 0
10 14 1 6
12 15 2 0
9 16 1 6
3 17 1 6
4 18 1 1
1 19 1 6
5 20 1 6
8 21 2 0
19 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
23 26 1 0
11 27 1 1
26 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 348.44Molecular Weight (Monoisotopic): 348.1937AlogP: 2.92#Rotatable Bonds: 3Polar Surface Area: 69.67Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.83CX LogD: 3.83Aromatic Rings: ┄Heavy Atoms: 25QED Weighted: 0.73Np Likeness Score: 3.13
References 1. Xue PH, Zhang N, Liu D, Zhang QR, Duan JS, Yu YQ, Li JY, Cao SJ, Zhao F, Kang N, Qiu F.. (2021) Cytotoxic and Anti-Inflammatory Sesquiterpenes from the Whole Plants of Centipeda minima ., 84 (2.0): [PMID:33533247 ] [10.1021/acs.jnatprod.0c00884 ]