The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3-((4-(1H-benzo[d]imidazol-2-yl)piperidin-1-yl)methyl)-4-fluorobenzyl)phthalazin-1(2H)-one ID: ALA4878133
PubChem CID: 164627096
Max Phase: Preclinical
Molecular Formula: C28H26FN5O
Molecular Weight: 467.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=c1[nH]nc(Cc2ccc(F)c(CN3CCC(c4nc5ccccc5[nH]4)CC3)c2)c2ccccc12
Standard InChI: InChI=1S/C28H26FN5O/c29-23-10-9-18(16-26-21-5-1-2-6-22(21)28(35)33-32-26)15-20(23)17-34-13-11-19(12-14-34)27-30-24-7-3-4-8-25(24)31-27/h1-10,15,19H,11-14,16-17H2,(H,30,31)(H,33,35)
Standard InChI Key: PDFONNRIEJFTRH-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
9.0510 -17.9534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2338 -17.9493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8239 -18.6511 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2267 -19.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0439 -19.3656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4583 -18.6593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2764 -18.6578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7543 -19.3206 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7592 -17.9985 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5354 -18.2537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5289 -19.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2316 -19.4821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9412 -19.0789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9438 -18.2594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2405 -17.8510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0068 -18.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5936 -19.3509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7778 -19.3404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3648 -20.0447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7689 -20.7560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5903 -20.7586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9996 -20.0538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8168 -20.0548 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.5476 -20.0390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1439 -19.3285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5593 -18.6246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1591 -17.9162 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3416 -17.9063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3278 -19.3256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9295 -18.6126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1148 -18.6020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6974 -19.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1006 -20.0174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9140 -20.0245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9389 -17.1952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 8 2 0
8 11 1 0
10 9 1 0
9 7 1 0
6 7 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
3 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
22 23 1 0
19 24 1 0
24 25 1 0
25 26 2 0
25 29 1 0
26 27 1 0
27 28 1 0
28 30 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
28 35 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.55Molecular Weight (Monoisotopic): 467.2121AlogP: 4.91#Rotatable Bonds: 5Polar Surface Area: 77.67Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.97CX Basic pKa: 8.26CX LogP: 4.32CX LogD: 3.50Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.39Np Likeness Score: -1.55
References 1. Shen H, Ge Y, Wang J, Li H, Xu Y, Zhu Q.. (2021) Design, synthesis and biological evaluation of novel molecules as potent PARP-1 inhibitors., 47 [PMID:34091044 ] [10.1016/j.bmcl.2021.128169 ]