4-(3-((4-(1H-benzo[d]imidazol-2-yl)piperidin-1-yl)methyl)-4-fluorobenzyl)phthalazin-1(2H)-one

ID: ALA4878133

PubChem CID: 164627096

Max Phase: Preclinical

Molecular Formula: C28H26FN5O

Molecular Weight: 467.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=c1[nH]nc(Cc2ccc(F)c(CN3CCC(c4nc5ccccc5[nH]4)CC3)c2)c2ccccc12

Standard InChI:  InChI=1S/C28H26FN5O/c29-23-10-9-18(16-26-21-5-1-2-6-22(21)28(35)33-32-26)15-20(23)17-34-13-11-19(12-14-34)27-30-24-7-3-4-8-25(24)31-27/h1-10,15,19H,11-14,16-17H2,(H,30,31)(H,33,35)

Standard InChI Key:  PDFONNRIEJFTRH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
    9.0510  -17.9534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2338  -17.9493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8239  -18.6511    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2267  -19.3614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0439  -19.3656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4583  -18.6593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2764  -18.6578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7543  -19.3206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7592  -17.9985    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5354  -18.2537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5289  -19.0701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2316  -19.4821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9412  -19.0789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9438  -18.2594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2405  -17.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0068  -18.6458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5936  -19.3509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7778  -19.3404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3648  -20.0447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7689  -20.7560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5903  -20.7586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9996  -20.0538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8168  -20.0548    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.5476  -20.0390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1439  -19.3285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5593  -18.6246    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1591  -17.9162    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3416  -17.9063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3278  -19.3256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9295  -18.6126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1148  -18.6020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6974  -19.3037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1006  -20.0174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9140  -20.0245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9389  -17.1952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  7  8  2  0
  8 11  1  0
 10  9  1  0
  9  7  1  0
  6  7  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  3 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 22 23  1  0
 19 24  1  0
 24 25  1  0
 25 26  2  0
 25 29  1  0
 26 27  1  0
 27 28  1  0
 28 30  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 28 35  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4878133

    ---

Associated Targets(Human)

PARP1 Tclin Poly [ADP-ribose] polymerase-1 (6206 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 467.55Molecular Weight (Monoisotopic): 467.2121AlogP: 4.91#Rotatable Bonds: 5
Polar Surface Area: 77.67Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.97CX Basic pKa: 8.26CX LogP: 4.32CX LogD: 3.50
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.39Np Likeness Score: -1.55

References

1. Shen H, Ge Y, Wang J, Li H, Xu Y, Zhu Q..  (2021)  Design, synthesis and biological evaluation of novel molecules as potent PARP-1 inhibitors.,  47  [PMID:34091044] [10.1016/j.bmcl.2021.128169]

Source