N2-(4-(tert-Butyl)phenyl)-5-chloro-N4-(3-trifluoromethyl)phenyl)pyrimidine-N4-diamine

ID: ALA4878148

PubChem CID: 156768820

Max Phase: Preclinical

Molecular Formula: C21H20ClF3N4

Molecular Weight: 420.87

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)c1ccc(Nc2ncc(Cl)c(Nc3cccc(C(F)(F)F)c3)n2)cc1

Standard InChI:  InChI=1S/C21H20ClF3N4/c1-20(2,3)13-7-9-15(10-8-13)28-19-26-12-17(22)18(29-19)27-16-6-4-5-14(11-16)21(23,24)25/h4-12H,1-3H3,(H2,26,27,28,29)

Standard InChI Key:  QEMREYNXFSAYQQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   17.9438   -2.9674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9426   -3.7870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6507   -4.1959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.3603   -3.7865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3575   -2.9638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6489   -2.5586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0637   -2.5526    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   20.0687   -4.1940    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.7758   -3.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4808   -4.1922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1874   -3.7832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1865   -2.9651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4732   -2.5578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7695   -2.9692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2346   -4.1950    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5272   -3.7859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8955   -4.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8964   -5.0082    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.2982   -3.4793    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.7109   -4.1891    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.5324   -2.9688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8258   -2.5597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1168   -2.9678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1188   -3.7892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8259   -4.1946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4089   -2.5596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4085   -1.7424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7014   -2.9686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6983   -2.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  4  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  2 15  1  0
 15 16  1  0
 11 17  1  0
 17 18  1  0
 17 19  1  0
 17 20  1  0
 16 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 16  1  0
 23 26  1  0
 26 27  1  0
 26 28  1  0
 26 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4878148

    ---

Associated Targets(Human)

CTSC Tchem Dipeptidyl peptidase I (1385 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L02 (4864 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 420.87Molecular Weight (Monoisotopic): 420.1329AlogP: 6.93#Rotatable Bonds: 4
Polar Surface Area: 49.84Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.65CX Basic pKa: 2.82CX LogP: 7.23CX LogD: 7.23
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.48Np Likeness Score: -1.63

References

1. Chen X, Yan Y, Zhang Z, Zhang F, Liu M, Du L, Zhang H, Shen X, Zhao D, Shi JB, Liu X..  (2021)  Discovery and In Vivo Anti-inflammatory Activity Evaluation of a Novel Non-peptidyl Non-covalent Cathepsin C Inhibitor.,  64  (16.0): [PMID:34374541] [10.1021/acs.jmedchem.1c00104]

Source