1-[(7S)-1,2,3-trimethoxy-10-(methylamino)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]guanidine dihydrochloride

ID: ALA4878150

PubChem CID: 164627106

Max Phase: Preclinical

Molecular Formula: C21H28Cl2N4O4

Molecular Weight: 398.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNc1ccc2c(cc1=O)[C@@H](NC(=N)N)CCc1cc(OC)c(OC)c(OC)c1-2.Cl.Cl

Standard InChI:  InChI=1S/C21H26N4O4.2ClH/c1-24-15-8-6-12-13(10-16(15)26)14(25-21(22)23)7-5-11-9-17(27-2)19(28-3)20(29-4)18(11)12;;/h6,8-10,14H,5,7H2,1-4H3,(H,24,26)(H4,22,23,25);2*1H/t14-;;/m0../s1

Standard InChI Key:  YOOAGOPYZHOKJF-UTLKBRERSA-N

Molfile:  

     RDKit          2D

 31 31  0  0  0  0  0  0  0  0999 V2000
    8.3164  -19.5053    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.0020  -15.8155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0008  -16.6309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7048  -17.0399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7030  -15.4108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4109  -16.6301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4116  -15.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0535  -15.2982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8547  -15.4725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2078  -16.2161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0535  -17.1385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8570  -16.9590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5062  -17.4733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6928  -17.8904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5114  -18.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0564  -18.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8654  -18.8132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0490  -19.6054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4511  -20.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2445  -18.6525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0208  -16.2143    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4279  -15.5057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2409  -15.5039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7056  -17.8529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2969  -17.0389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2983  -15.4112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2981  -14.5981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5937  -16.6298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0025  -18.2581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0177  -14.7989    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5121  -15.2377    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  6  2  0
  7  5  2  0
  5  2  1  0
  6  7  1  0
  7  8  1  0
  6 11  1  0
  8  9  1  0
  9 10  1  0
 12 10  1  0
 11 12  1  0
 12 13  2  0
 11 14  2  0
 13 15  1  0
 14 16  1  0
 15 17  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 15 20  2  0
 10 21  1  6
 21 22  1  0
 22 23  1  0
  4 24  1  0
  3 25  1  0
  2 26  1  0
 26 27  1  0
 25 28  1  0
 24 29  1  0
 22 30  2  0
M  END

Associated Targets(Human)

LoVo (4724 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

BALB/3T3 (534 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 398.46Molecular Weight (Monoisotopic): 398.1954AlogP: 2.25#Rotatable Bonds: 5
Polar Surface Area: 118.69Molecular Species: BASEHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 11.98CX LogP: 0.99CX LogD: -1.42
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.45Np Likeness Score: 0.75

References

1. Krzywik J, Maj E, Nasulewicz-Goldeman A, Mozga W, Wietrzyk J, Huczyński A..  (2021)  Synthesis and antiproliferative screening of novel doubly modified colchicines containing urea, thiourea and guanidine moieties.,  47  [PMID:34116158] [10.1016/j.bmcl.2021.128197]

Source