The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-[(7S)-1,2,3-trimethoxy-10-(methylamino)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]guanidine dihydrochloride ID: ALA4878150
PubChem CID: 164627106
Max Phase: Preclinical
Molecular Formula: C21H28Cl2N4O4
Molecular Weight: 398.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNc1ccc2c(cc1=O)[C@@H](NC(=N)N)CCc1cc(OC)c(OC)c(OC)c1-2.Cl.Cl
Standard InChI: InChI=1S/C21H26N4O4.2ClH/c1-24-15-8-6-12-13(10-16(15)26)14(25-21(22)23)7-5-11-9-17(27-2)19(28-3)20(29-4)18(11)12;;/h6,8-10,14H,5,7H2,1-4H3,(H,24,26)(H4,22,23,25);2*1H/t14-;;/m0../s1
Standard InChI Key: YOOAGOPYZHOKJF-UTLKBRERSA-N
Molfile:
RDKit 2D
31 31 0 0 0 0 0 0 0 0999 V2000
8.3164 -19.5053 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.0020 -15.8155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0008 -16.6309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7048 -17.0399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7030 -15.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4109 -16.6301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4116 -15.8119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0535 -15.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8547 -15.4725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2078 -16.2161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0535 -17.1385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8570 -16.9590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5062 -17.4733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6928 -17.8904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5114 -18.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0564 -18.6362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8654 -18.8132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0490 -19.6054 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4511 -20.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2445 -18.6525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0208 -16.2143 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4279 -15.5057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2409 -15.5039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7056 -17.8529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2969 -17.0389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2983 -15.4112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2981 -14.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5937 -16.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0025 -18.2581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0177 -14.7989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5121 -15.2377 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 6 2 0
7 5 2 0
5 2 1 0
6 7 1 0
7 8 1 0
6 11 1 0
8 9 1 0
9 10 1 0
12 10 1 0
11 12 1 0
12 13 2 0
11 14 2 0
13 15 1 0
14 16 1 0
15 17 1 0
16 17 2 0
17 18 1 0
18 19 1 0
15 20 2 0
10 21 1 6
21 22 1 0
22 23 1 0
4 24 1 0
3 25 1 0
2 26 1 0
26 27 1 0
25 28 1 0
24 29 1 0
22 30 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 398.46Molecular Weight (Monoisotopic): 398.1954AlogP: 2.25#Rotatable Bonds: 5Polar Surface Area: 118.69Molecular Species: BASEHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 11.98CX LogP: 0.99CX LogD: -1.42Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.45Np Likeness Score: 0.75
References 1. Krzywik J, Maj E, Nasulewicz-Goldeman A, Mozga W, Wietrzyk J, Huczyński A.. (2021) Synthesis and antiproliferative screening of novel doubly modified colchicines containing urea, thiourea and guanidine moieties., 47 [PMID:34116158 ] [10.1016/j.bmcl.2021.128197 ]