4-((2S)-2-(2-(3-chloro-2-fluorophenyl)-1-methoxy-4-methyl-1H-imidazole-5-carboxamido)-3-phenylpropanamido)benzoic acid

ID: ALA4878154

PubChem CID: 164627293

Max Phase: Preclinical

Molecular Formula: C28H24ClFN4O5

Molecular Weight: 550.97

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COn1c(-c2cccc(Cl)c2F)nc(C)c1C(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1ccc(C(=O)O)cc1

Standard InChI:  InChI=1S/C28H24ClFN4O5/c1-16-24(34(39-2)25(31-16)20-9-6-10-21(29)23(20)30)27(36)33-22(15-17-7-4-3-5-8-17)26(35)32-19-13-11-18(12-14-19)28(37)38/h3-14,22H,15H2,1-2H3,(H,32,35)(H,33,36)(H,37,38)/t22-/m0/s1

Standard InChI Key:  PATRFUVZHXBMCD-QFIPXVFZSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
    8.5392   -3.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2469   -3.2646    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9547   -3.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9521   -4.4915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6590   -4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3677   -4.4914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3651   -3.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6576   -3.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0759   -4.8990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0770   -5.7162    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7831   -4.4895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8315   -3.2646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1238   -3.6732    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4161   -3.2646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5392   -4.4904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8315   -2.4474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5392   -2.0389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2465   -2.4504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9537   -2.0425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9542   -1.2244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2415   -0.8160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5372   -1.2262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4161   -2.4474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7084   -3.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9605   -3.3452    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4137   -3.9525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8223   -4.6603    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6216   -4.4902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2286   -5.0373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6058   -3.8694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2742   -3.1213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4622   -3.0356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9810   -3.6972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3175   -4.4465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1285   -4.5286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7884   -2.5464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3942   -1.9979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8395   -5.1093    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.4629   -5.2742    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  6  9  1  0
  9 10  2  0
  9 11  1  0
  1 12  1  0
 12 13  1  0
 13 14  1  0
  1 15  2  0
 12 16  1  1
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 14 23  2  0
 14 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 24  2  0
 28 29  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 26 30  1  0
 25 36  1  0
 36 37  1  0
 34 38  1  0
 35 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4878154

    ---

Associated Targets(Human)

F11 Tchem Coagulation factor XI (1733 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 550.97Molecular Weight (Monoisotopic): 550.1419AlogP: 4.39#Rotatable Bonds: 9
Polar Surface Area: 122.55Molecular Species: ACIDHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.16CX Basic pKa: 2.34CX LogP: 4.14CX LogD: 1.19
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.28Np Likeness Score: -0.95

References

1. Lei Y, Zhang B, Zhang Y, Dai X, Duan Y, Mao Q, Gao J, Yang Y, Bao Z, Fu X, Ping K, Yan C, Mou Y, Wang S..  (2021)  Design, synthesis and biological evaluation of novel FXIa inhibitors with 2-phenyl-1H-imidazole-5-carboxamide moiety as P1 fragment.,  220  [PMID:33894565] [10.1016/j.ejmech.2021.113437]

Source