N,N'-(4,4'-methylenebis(2-methyl-4,1-phenylene))dithiophene-2-carboxamide

ID: ALA4878165

PubChem CID: 1377411

Max Phase: Preclinical

Molecular Formula: C25H22N2O2S2

Molecular Weight: 446.60

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(Cc2ccc(NC(=O)c3cccs3)c(C)c2)ccc1NC(=O)c1cccs1

Standard InChI:  InChI=1S/C25H22N2O2S2/c1-16-13-18(7-9-20(16)26-24(28)22-5-3-11-30-22)15-19-8-10-21(17(2)14-19)27-25(29)23-6-4-12-31-23/h3-14H,15H2,1-2H3,(H,26,28)(H,27,29)

Standard InChI Key:  DJZVKXZUNBYXNG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   27.1567  -20.2706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1555  -21.0980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8704  -21.5108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5867  -21.0975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5839  -20.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8685  -19.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2969  -19.8518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0128  -20.2616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0125  -21.0843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7278  -21.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4416  -21.0787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4359  -20.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7201  -19.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8702  -22.3358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1473  -19.8317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1582  -21.4876    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.8706  -21.0715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5871  -21.4803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8663  -20.2465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.6785  -22.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4863  -22.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8952  -21.7465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3399  -21.1363    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   26.4407  -21.5099    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7266  -21.0968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0118  -21.5088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7272  -20.2719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.2618  -21.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7093  -21.7876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1213  -22.5024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9283  -22.3314    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  3 14  1  0
 12 15  1  0
 11 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 18 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 18  1  0
  2 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 26  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

GPR174 Tchem Probable G-protein coupled receptor 174 (370 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.60Molecular Weight (Monoisotopic): 446.1123AlogP: 6.52#Rotatable Bonds: 6
Polar Surface Area: 58.20Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 7.10CX LogD: 7.10
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.35Np Likeness Score: -1.22

References

1.  (2020)  Inhibitors of GPR174 and Uses Thereof, 
2.  (2020)  Methods and Compositions for Treating Cancer, 

Source