The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(4,4'-methylenebis(2-methyl-4,1-phenylene))dithiophene-2-carboxamide ID: ALA4878165
PubChem CID: 1377411
Max Phase: Preclinical
Molecular Formula: C25H22N2O2S2
Molecular Weight: 446.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(Cc2ccc(NC(=O)c3cccs3)c(C)c2)ccc1NC(=O)c1cccs1
Standard InChI: InChI=1S/C25H22N2O2S2/c1-16-13-18(7-9-20(16)26-24(28)22-5-3-11-30-22)15-19-8-10-21(17(2)14-19)27-25(29)23-6-4-12-31-23/h3-14H,15H2,1-2H3,(H,26,28)(H,27,29)
Standard InChI Key: DJZVKXZUNBYXNG-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
27.1567 -20.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1555 -21.0980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8704 -21.5108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5867 -21.0975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5839 -20.2670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8685 -19.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2969 -19.8518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0128 -20.2616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0125 -21.0843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7278 -21.4940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4416 -21.0787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4359 -20.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7201 -19.8435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8702 -22.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1473 -19.8317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1582 -21.4876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8706 -21.0715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5871 -21.4803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8663 -20.2465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.6785 -22.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4863 -22.4631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8952 -21.7465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3399 -21.1363 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
26.4407 -21.5099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7266 -21.0968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0118 -21.5088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7272 -20.2719 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2618 -21.1749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7093 -21.7876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1213 -22.5024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9283 -22.3314 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
3 14 1 0
12 15 1 0
11 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
18 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 18 1 0
2 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.60Molecular Weight (Monoisotopic): 446.1123AlogP: 6.52#Rotatable Bonds: 6Polar Surface Area: 58.20Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.10CX LogD: 7.10Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.35Np Likeness Score: -1.22
References 1. (2020) Inhibitors of GPR174 and Uses Thereof, 2. (2020) Methods and Compositions for Treating Cancer,